0
What else can I help you with?
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
The molecule is called butane. It consists of four carbon atoms in a chain with each carbon having hydrogen atoms attached, including the end carbons which each have 3 hydrogens.
What is the structural formula of 3 - methylnonane?
It is a straight carbon chain composed of nine carbons with a methyl (-CH3) group attached to the third carbon. CH3-CH2-CHMe-CH2-CH2-CH2-CH2-CH2-CH3
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the structual formula of polypropene with three monomers?
The structural formula of polypropene with three monomers would be (CH2-CHCH3)n, where n represents the number of repeating units. Each monomer unit consists of a propylene molecule, which is made up of a chain of three carbon atoms with attached hydrogen atoms.
How many atoms in ch3(ch2)14cooh?
The molecular formula for CH3(CH2)14COOH can be expanded to show all the atoms: it contains 16 carbon (C) atoms, 32 hydrogen (H) atoms, and 2 oxygen (O) atoms. Therefore, the total number of atoms in the molecule is 16 + 32 + 2 = 50 atoms.
What is the nomenclature for ch3 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
The nomenclature for CH3CH2CH2CH2CH2CH2CH2CH3 is octane. It is an alkane with 8 carbon atoms in a straight chain.
Is CH3 -CH2 -CH3 a pentane?
No. The formula is for propane, not pentane. A pentane would have five carbon atoms, and this formula shows only three.
What is the hydrocarbon for this chemical formula ch3-ch2-ch2-ch2-ch2-ch3?
The chemical formula CH3-CH2-CH2-CH2-CH2-CH3 represents the alkane hexane. Hexane is a straight-chain hydrocarbon with six carbon atoms and single bonds, making it an example of an aliphatic hydrocarbon. It is commonly used as a solvent in various industries.
What is the hybridization of -ch3?
The hybridization of CH3 is sp3. Each carbon atom forms four sigma bonds with hydrogen atoms, resulting in a tetrahedral geometry and sp3 hybridization.
What is the name of ch3-ch2-ch2-ch3 with single bondof ch3?
The molecule is called butane. It consists of four carbon atoms in a chain with each carbon having hydrogen atoms attached, including the end carbons which each have 3 hydrogens.
What is CH2-CH2-CH3?
If its along the lines of chemistry it is hexane
How do you find oxidation number of carbon in CH3-CH2-OH?
The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.
Cite examples of chemicals that contains carbon-carbon bonds?
ethane CH3-CH3 propane CH3-CH2-CH3 butane CH3-CH2-CH2-CH3 (all the above are alkanes, their are a lot of other types of hydrocarbons and carbon-carbon bonds)
How many carbon atoms are found in the chemical formula of propane?
CH3-CH2-CH3 = PROPANE. there are there carbon atoms.
What is the name compound ch3-ch2-ch2-chch2?
CH3-CH2-CH2-CH=CH2 will be names as 1-pentene or pent-1-ene
What is the structural formula of 3 - methylnonane?
It is a straight carbon chain composed of nine carbons with a methyl (-CH3) group attached to the third carbon. CH3-CH2-CHMe-CH2-CH2-CH2-CH2-CH2-CH3
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
