0
What else can I help you with?
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the condensed structural formula for C5H12?
CH3(CH2)3CH3 Strung out it is CH3-CH2-CH2-CH2-CH3
What is ch3-ch2-ch2-ch2-ch3?
This molecule is called 2-MethylHexane.Additional Information:2-MethylHexane is a common solvent and is often found under the names, ethylisobutylmethane and isoheptane, as well as some other less common names.
What is the structural formula for 24-dimethylpentane?
There is no chemical compound named 24-dimethyl pentane. There is a compound named 2,4-dimethyl pentane, which has the following structural formula, using a common convention when trying to represent structural formulas with a limited type font set: CH3-CH(CH3)-CH2-CH(CH3)-CH3. In this convention, a group within parentheses represents a side group bonded, via a carbon-carbon bond between the first carbon within the parentheses and the immediately previously written carbon atom that is not within parentheses.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the name for CH3 CH2?
pentane
What is the chemical formula is pentene?
Pentane is C5H12 The Structure is as follows. CH3-CH2-CH2-CH2-CH3
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the condensed structural formula for C5H12?
CH3(CH2)3CH3 Strung out it is CH3-CH2-CH2-CH2-CH3
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is lowest molicular formula of alkane which contains one chiral carbon?
2-ethylpentane as it the carbon carbon atom in the pentane backbone has four different groups such as -H, -CH3, -CH2-CH3 and -CH2-CH2-CH3. The molecule is still an alkane because it does not have any double bonds and is made of just carbon and hydrogen.
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is ch3-ch2-ch2-ch2-ch3?
This molecule is called 2-MethylHexane.Additional Information:2-MethylHexane is a common solvent and is often found under the names, ethylisobutylmethane and isoheptane, as well as some other less common names.
What is the structural formula for 24-dimethylpentane?
There is no chemical compound named 24-dimethyl pentane. There is a compound named 2,4-dimethyl pentane, which has the following structural formula, using a common convention when trying to represent structural formulas with a limited type font set: CH3-CH(CH3)-CH2-CH(CH3)-CH3. In this convention, a group within parentheses represents a side group bonded, via a carbon-carbon bond between the first carbon within the parentheses and the immediately previously written carbon atom that is not within parentheses.
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the proper configuration of a straight chain isomer of hexane?
Ch3-ch2-ch2-ch2-ch2-ch3
