answersLogoWhite

0

There is no chemical compound named 24-dimethyl pentane. There is a compound named 2,4-dimethyl pentane, which has the following structural formula, using a common convention when trying to represent structural formulas with a limited type font set:

CH3-CH(CH3)-CH2-CH(CH3)-CH3.

In this convention, a group within parentheses represents a side group bonded, via a carbon-carbon bond between the first carbon within the parentheses and the immediately previously written carbon atom that is not within parentheses.

User Avatar

Wiki User

12y ago

What else can I help you with?

Related Questions

What is the Structural formula for 3-methyl-1-butene?

structural formula of c5h10


What is the structural formula for ethyl butanoate?

The structural formula for ethyl butanoate is CH3CH2CH2COOCH2CH3.


The dichloropropane structural formula and condense formula of di?

The structural formula for dichloropropane is ClCH₂CHCl₂, and its condensed formula is CH₃CHCl₂.


What is the structural formula for aspirin?

The structural formula of aspirin is HOOC-C6H4-OCOCH3(C9H8O4).


What is structural formula of 3-oxopentanal?

The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.


How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.


What is the difference between a chemical formulamolecular formula and a structural formula?

A structural formula represents the molecule graphically, whereas the other does not.


What is structural formula for sodium hypochlorite?

The chemical formula for lithium chlorate is LiClO3.


What does a structural formula shows about a molecule of a compound?

The structural formula show the spatial aspect of the molecule.


What is the difference between structural and condensed formula?

The structural formula show the position of atoms in a molecule.


What is the condensed structural formula for N Methylaniline?

The condensed structural formula for N-methylaniline is CH3C6H4NH2.


What does structural formula show about a molecule of a compound?

The structural formula show the spatial aspect of the molecule.