0
What else can I help you with?
What is the hybridization of ion CH3 plus?
This carbocation which only has six electrons is isoelectronic with BH3 and is believed to have a similar structure as gaseous molecular BH3, planar with bond angles of 120 0. The hybridisation would be sp2 with and empty p orbital.
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
What is the hybridization of the central atom in ccl4?
Prsumably you mean AlH4- the tetrahydroaluminate anion. The hybridization of the central atom of AlH4 is sp3.
What is the hybridization of NCl3?
The hybridization of NCl3 is sp3.
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
What is the hybridization of ion CH3 plus?
This carbocation which only has six electrons is isoelectronic with BH3 and is believed to have a similar structure as gaseous molecular BH3, planar with bond angles of 120 0. The hybridisation would be sp2 with and empty p orbital.
What are the hybridization of the carbon atoms in CH3 CH2 COH?
The C in h3c is sp3 hybridized The c in ch is sp2 hybridized the c in ch2 is sp2 hybridized
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
what is the formula for "2-bromo-2-methylpropane + H2O →2-methylpropan-2-ol + HBr"?
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
