If its along the lines of chemistry it is hexane
The propyl group is a three-carbon alkyl group with the formula C3H7. It can be represented as -CH2CH2CH3.
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
The compound CH3CH2OCH2H2CH3 is named ethyl propyl ether. It consists of an ethyl group (CH3CH2) connected to a propyl group (CH2CH2CH3) through an oxygen atom in the middle.
The word eq'n is Ethanoic acid + propanol = propylethanoate + water. The chemical equation is CH3C(=O)-OH + CH3CH2CH2OH CH3C(=O)-O-CH2CH2CH3 + H2O)
The propyl group is a three-carbon alkyl group with the formula C3H7. It can be represented as -CH2CH2CH3.
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
Bonds between carbon and hydrogen are non-polar.
dimethylamine
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
The compound CH3CH2OCH2H2CH3 is named ethyl propyl ether. It consists of an ethyl group (CH3CH2) connected to a propyl group (CH2CH2CH3) through an oxygen atom in the middle.
The word eq'n is Ethanoic acid + propanol = propylethanoate + water. The chemical equation is CH3C(=O)-OH + CH3CH2CH2OH CH3C(=O)-O-CH2CH2CH3 + H2O)
2-pentanone is a ketone with a carbonyl group attached to a five-carbon chain, while 2-pentanol is an alcohol with the -OH group attached to the same five-carbon chain. 2-pentanone has a carbonyl group, giving it a characteristic ketone odor. 2-pentanol is an alcohol, making it more polar and having different physical properties compared to 2-pentanone.
The condensed structural formula for 3-ethyl-2,5-dimethyloctane is CH3CH(CH2CH3)CH(CH3)C(CH3)2CH2CH2CH3.
Balanced reaction: C4H10 + 13/2 O2 --> 4CO2 + 5H2O
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3 24 hydrogen
Ethyl propyl ether. The formula should be correctly written as CH3-CH2-O-CH2-CH2-CH3 Note the use of capitals, particularly for Hydrogen (H) , not 'h'.