answersLogoWhite

0

Carbon dioxide.

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What is the general equation for water and sodium carbonate?

No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.


What is the balanced equation for the reaction of the oxide of sodium with water?

The balanced equation for the reaction of sodium oxide with water is: Na2O + H2O → 2NaOH


What is the reaction equation for water and sodium carbonate?

The reaction equation for water and sodium carbonate is: Na2CO3 + H2O → 2 NaOH + CO2


What is the reaction equation between sodium sulfate and water?

They don't react sodium sulphate simply becomes ionized in water producing Na+ and SO42- ions.


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).


What is the product of a reaction that take place when sodium oxide combines with water?

The reaction between sodium oxide (Na2O) and water (H2O) forms sodium hydroxide (NaOH). The chemical equation for this reaction is: Na2O + H2O -> 2NaOH


What is the chemical equation of ethanoic acid reacting with sodium hydroxide?

The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.


What is the chemical equation showing the reaction between sodium and water?

2Na + H2O -> 2NaOH+H2


What is the ionic equation for chlorine and sodium hydroxide?

The ionic equation for the reaction between chlorine and sodium hydroxide is: Cl2 + 2NaOH → NaCl + NaClO + H2O This reaction produces sodium hypochlorite (NaClO) and sodium chloride (NaCl) along with water (H2O).


Equation for reaction of benzoic acid and sodium bicarbonate?

The reaction between benzoic acid and sodium bicarbonate produces sodium benzoate, carbon dioxide, and water. The balanced chemical equation for this reaction is: C6H5COOH + NaHCO3 -> C6H5COONa + CO2 + H2O


What is the equation for sodium reacting with water?

Sodium reacting with water is: 2Na + 2H2O ----> 2NaOH + H2


What is the word equasion for sodium in water?

sodium and water =sodium + water -> sodium hydroxide + hydrogen and this is the right answer because i got it of a scientist