0
It is wrong. Cations are smaller than ions. It is because when cations are formed the outer shell of the element is removed but this does not happen with anions.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Is salt a hydrophilic or hydrophobic?
No. Instead, salt is hydrophilic ("water-loving"). Salt (NaCl, or Na+ and Cl-) is very attracted to Water (H20, or H2+ and O-) because opposite electrostatic charges attract. The anionic ("negatively charged") Chlorine end of the salt molecule is attracted to the 2 cationic ("positively charged") Hydrogen ions of the water molecule: Cl- wants H2+. In the same way, the cationic Sodium end is attracted to the anionic Oxygen end: Na+ wants O-. Since each end of the salt molecule is attracted to the reciprocal end of the water molecule, there is a strong overall molecular attraction.
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
Examples of molecular ions?
Co+ , ch4+ , n2+ ,c2h6 etc are example of molecular ion.
Is NaOH molecular or ionic?
Ionic (made up of the ions Na+ and OH- )
Is it true or false molecular compounds that dissolve in water do not conduct electricity because no charged ions are present?
That, for the most part, would be true. If the compound is truly molecular, then ions would not form, and it would be a non electrolyte.
What is the complex salts?
A complex salt is the salt of one or more complex ions, the complex part can be cationic or anionic or both such as Ca3[Co(Cl)6]2 the complex part behaves as an anion [Co(NH3)6]Cl3 the complex part behaves as a cation [Co(NH3)6][Co(Cl)6] the both of the anionic and cationic parts of the are formed by complex ions
Do giant molecules have charged ions?
Yes, polyurethane dispersions are usually anionic and have very large molecular weights.
Is salt a hydrophilic or hydrophobic?
No. Instead, salt is hydrophilic ("water-loving"). Salt (NaCl, or Na+ and Cl-) is very attracted to Water (H20, or H2+ and O-) because opposite electrostatic charges attract. The anionic ("negatively charged") Chlorine end of the salt molecule is attracted to the 2 cationic ("positively charged") Hydrogen ions of the water molecule: Cl- wants H2+. In the same way, the cationic Sodium end is attracted to the anionic Oxygen end: Na+ wants O-. Since each end of the salt molecule is attracted to the reciprocal end of the water molecule, there is a strong overall molecular attraction.
What causes a stain to adhere to bacteria cells and why all colored dyes not necessarily useful for simple staining?
The causes a stain adheres to bacterial cells is the color-bearing ions (chromophores) and they might be positively charged (cationic), such as methylene blue, basic fuchsin, and crystal violet, because bacteria are negatively charged and anionic chromophores, such as eosin, will not stain bacteria because of the electrostatic repelling forces that are involved.
What is the difference of pH on the levels of mundane and spiritual?
'This letter somewhat explains it ?'Alkaline, Anionic, Acid, Cationic...A letter from Michael Olszta, RBTI ConsultantThe lemon is not an acid in Reams terminology since an acid to him is a cation. Let's go back to basics in RBTI nomenclature and let's look at a simple atom of Nitrogen which can be either anionic or cationic:Anionic Nitrogen - One atom would have 1 cation in the core and 1 anion in the shell in orbit. The cation in the core is rotating counterclockwise as you look down upon it and it is positively charged. The anion in the shell is rotating clockwise and is negatively charged.Cationic Nitrogen - One atom would have 1 anion in the core and 1 cation in the shell in orbit. The anion in the core is rotating clockwise as you look down upon it and it is negatively charged. The cation in the shell is rotating counterclockwise and is positively charged.Which direction would the anionic nitrogen be moving? It would be moving up toward the Van Allen Belt which is anionic.Which direction would the cationic nitrogen be moving? It would be moving down toward the earth which is cationic.How many Milhouse units of energy are in the electron of the shell of the anionic nitrogen? 1 to 499.How many Milhouse units of energy are in the proton of the core of the anionic nitrogen? 500 to 999.How many Milhouse units of energy are in the electron of the shell of the cationic nitrogen? 500 to 999.How many Milhouse units of energy are in the proton of the core of the cationic nitrogen? 1 to 499.Nitrogen is an isotope which, in RBTI terminology, is an element that can be either cationic (positively charged, turning counter clockwise, and heading downward toward the earth) or anionic (negative charged, turning clockwise, heading upward toward the Van Allen Belt).pH has nothing to do with an element being cationic or anionic. It only measures the resistance between the two. Read Beddoe's definitions:pH - A measure of resistance. A pH of 7 means that there is an equal resistance between anions and cations. (Olszta's note: however, it doesn't indicate whether the substance being tested is anionic or cationic)Resistance - The effect produced when anions and anions or cations and cations or anions and cations of differing Milhouse unit value encounter each other. One could say that resistance is a type of friction which causes energy to be given off. (Olszta's note: however, it doesn't indicate whether the substance is anionic or cationic)Beddoe defines acid as being "a solution with a resistance range (pH) from 00-7.0. However, Dr. Reams does not define it that way. The terms "acid" and "alkaline" are (at least as far as I can see) defined by Dr. Reams as being cationic and anionic (according to the aforementioned definitions) respectively. Therefore, when Dr. Reams speaks of HCL being anionic and/or a base, those two terms mean the same to him and refer only to the direction and charge of the ions both in the core and shell of the molecule.Back to the lemon: Even though the pH is "acid" per Beddoe's definition in the previous paragraph, according to Dr. Reams it is really "alkaline" seeing that acid and alkaline to him refer to the charge and spinning direction of the ions that make up the substance. So I have to assume that the atomic structure of the shell of the molecules making up the lemon is an anionic pattern (negatively charged, turning clockwise and upwards toward the Van Allen Belt) yet the resistance or the friction between the anions and anions, cations and cations, and anions and cations is giving off more cationic energy and hence the "acid" pH reading.Go back to Beddoe's book in the chapter pH Principleswhere he discusses the principles of tissue change from the best line of resistance (Chapter 7 / 77 in my copy). He gives a chart where he shows what is happening when the body chemistry is going Toward Cationic versus Toward Anionic. He then describes how when the chemistry moves to cationic, the actual breakdown is occurring in the upper (more anionic) part of the organ as the energy is flowing down from the top and moving through the bottom of the organ. Hence, the pH will give an acidic reading. It will be vice versa if the energy flow is moving upward, i.e., the loss of energy is coming from the bottom part of the organ and going out through the top of the organ and being lost in anions and hence there will be an alkaline pH reading. BUT THIS HAS NOTHING TO DO WITH THE OVERALL STRUCTURE OF THE BODY, i.e., THAT OUR BODIES ARE CATIONIC BODIES, NOT ANIONIC BODIES. The pH is only measuring the resistance or lack of resistance of the energy flow in the body.Back to the so called "acid" lemon AGAIN! The energy being lost in the lemon is being lost from the top of the atomic molecule structure downward, that is, the resistance of the electrical flow of energy in the lemon is lower than neutral and hence the pH reads acid. But the overall structure of the lemon is anionic (I'm taking Dr. Reams at his word here) meaning that the core nitrogen of every molecule is cationic but the elements in orbit in the molecule are circling in such a fashion (clockwise) and are negatively charged to make the lemon anionic.At least that's the way I see it. It was always hammered into our heads that pH is only a measure of resistance, not a measure of quantity or quality. And I don't think it is possible to understand the RBTI unless one can get this most important point into one's mind. Reams said all foods are cationic except the lemon, yet the lemon turns out to be acid on the pH scale and I dare say that many foods we eat would end up being alkaline if we tested the pH of them.But again, the pH is only showing the resistance or lack thereof and the result of the friction between the ions and the energy being given off by them. It does not tell us if the substance is anionic or cationic; it only tells us how the energy is being lost.
Molecular ion are composed of more than one atom?
molecular ions
How do you convert grams to ions?
You cannot. Different ions have different molecular masses.
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
Examples of molecular ions?
Co+ , ch4+ , n2+ ,c2h6 etc are example of molecular ion.
What are the compounds or ions for N2O5?
N2O5 is a molecular compound, not ionic.
How many lines are there in the mass spectrum which makes atomic positive ions and molecular positive ions of a sample of hydrogen containing H2 HD D2 HT T2 DT?
9. 3 from the atomic ions- H+, D+, T+ plus 6 molecular ions as listed
What is the difference between positively charged molecular ions and positively charged ions having group of atoms?
Molecular Ions essentially consist of the same type of atoms (most probably the atoms of the same element) and the radicals may not have the same characteristic.
