0
What else can I help you with?
Is ((ch3)3Nh)cl acid or base?
((CH3)3NH)Cl is a salt formed by the reaction of the base trimethylamine ((CH3)3NH) and hydrochloric acid (HCl). Trimethylamine is a weak base, so ((CH3)3NH)Cl would be considered acidic.
What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?
The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.
Is (CH3)3N a strong or weak acid or base?
(CH3)3N, also known as trimethylamine, is a weak base. It can accept a proton to form the ammonium ion, but it does not readily donate a proton like a strong base would.
Is ch3 an acid?
CH3 is not an acid by itself. It is actually a methyl group, which is a functional group commonly found in organic compounds. Acids typically contain hydrogen ions that can be donated in a reaction, whereas CH3 does not have any acidic properties.
Is butanol a base?
In spite of the same OH group as in bases, butanol is not a hydroxide (base, alkaline) it is an alcohol (alkanol) in the organic group of compounds: they do not ionise or hydrolyse in water, no OH- ions are split off.There are 3 formula isomers of butanol: CH2OH-CH2-CH2-CH3 (1-butanol) and CH3-CH(OH)-CH2-CH3 (2R-butanol) and CH3-C(OH)H-CH2-CH3 (2S-butanol), the '2R' and '2S' butanol formula's are mirror isomers.
Is ((ch3)3Nh)cl acid or base?
((CH3)3NH)Cl is a salt formed by the reaction of the base trimethylamine ((CH3)3NH) and hydrochloric acid (HCl). Trimethylamine is a weak base, so ((CH3)3NH)Cl would be considered acidic.
What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?
The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.
Is (CH3)3N a strong or weak acid or base?
(CH3)3N, also known as trimethylamine, is a weak base. It can accept a proton to form the ammonium ion, but it does not readily donate a proton like a strong base would.
Is (ch3)3cona acidic?
Sodium tery-butoxide is a strong base.
Is ch3 an acid?
CH3 is not an acid by itself. It is actually a methyl group, which is a functional group commonly found in organic compounds. Acids typically contain hydrogen ions that can be donated in a reaction, whereas CH3 does not have any acidic properties.
Is butanol a base?
In spite of the same OH group as in bases, butanol is not a hydroxide (base, alkaline) it is an alcohol (alkanol) in the organic group of compounds: they do not ionise or hydrolyse in water, no OH- ions are split off.There are 3 formula isomers of butanol: CH2OH-CH2-CH2-CH3 (1-butanol) and CH3-CH(OH)-CH2-CH3 (2R-butanol) and CH3-C(OH)H-CH2-CH3 (2S-butanol), the '2R' and '2S' butanol formula's are mirror isomers.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
