0
Why does the smell of an ester become more prominent when it is poured into water?
Wiki User
∙ 10y ago
Mr. Yahia Maharmeh says that Because the reactions are slow and reversible, you don't get a lot of ester produced in this time. The smell is often masked or distorted by the smell of the carboxylic acid. A simple way of detecting the smell of the ester is to pour the mixture into some water in a small beaker.Apart from the very small ones, esters are fairly insoluble in water and tend to form a thin layer on the surface. Excess acid and alcohol both dissolve and are tucked safely away under the ester layer.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What smell does the ester from n-amyl alcohol and acetic acid have?
banana
What are the uses for an ester?
perfumes, essential oils, pheromones, and they give fruits their smell.
Why does your house smell like amonia?
Ammonia is a by product or component of urine, particularly strong in feline (cat) urine. Chances are you have a cat, or a cat once lived in the house. This will become more noticeable and prominent if that cat is male and has been marking his territory within the house.
What is the difference between dettol and savlon?
Dettol has a stong smell and turns cloudy when poured on water, whereas savlon does not turn cloudy in water. No sting property of savlon is the key differentiator
What ester is produced from salicylic acid and methyl alcohol?
Organic acids and alcohols are reacted (in the presence of a dehydrating agent) to produce esters. And these substances are often recognized by their characteristic odors. In the case here, salicylic acid and methyl alcohol yield methyl salicylate, which is winter-green.
What smell does the ester from n-amyl alcohol and acetic acid have?
banana
How would you notice the presence of esters in fruit such as pinneapple?
Esters are aromatic, you would smell them - the smell of pineapple is an ester.
What does a banana smell like?
The smell is difficult or impossible to compare except in relation to other subjective smells. Part of the smell consists of an ester called isoamyl acetate, also found in pears. The human nose would probably find it difficult to distinguish between the presence of the chemical and the presence of an actual banana. The ester is also found in bees, where it is a pheromone released when the bee stings.
What is an observable characteristic of an ester?
Esters are used for perfumes, or artificial flavoring. It smells sweet, typically.
Why are the olfactory lobe in rat are more prominent than in human?
Because a rat relies more on its sense of smell.
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
Orange tastes like?
Oranges taste and smell like Octyl acetate, or octyl ethanoate. It is an organic compound with the formula CH3(CH2)7O2CCH3. It is an ester as are most fruity odours . The smell of an orange is similar to Limonene (a cyclic terpene).
What are the uses for an ester?
perfumes, essential oils, pheromones, and they give fruits their smell.
Why does your house smell like amonia?
Ammonia is a by product or component of urine, particularly strong in feline (cat) urine. Chances are you have a cat, or a cat once lived in the house. This will become more noticeable and prominent if that cat is male and has been marking his territory within the house.
What is the content of ethyl acetate in a banana?
The smell of bananas comes from the ester 3-methylbutyl acetate. Ethyl acetate has a smell similar to that of bananas and is often used in banana fragrances as well as being naturally found in some wines. The ester 3-methylbutyl acetate (isopentyl acetate) is an artificial banana scent/flavor. While we perceive the smell of this compound as the smell of bananas, the chemical is not responsible for the scent/flavor of real bananas. Banana candies (runts for example) use 3-methylbutyl acetate as the artificial flavoring and any true banana lover could tell you that the candies taste different than the fruit.
What subsance poured from the tank that broke in the North End of Boston in 1919?
Molasses. It killed several people when it broke. They say on a hot day you can still smell the molasses.
What does panda smell do to your ears?
It can cause ears to become rounder. In rare cases they can also become darker.
