0
What else can I help you with?
What is balanced chemical equation for reaction between naoh plus ch3cooh?
NaOH + CH3COOH = CH3COONa + H2O Good Luck !
Chemical equation for the reaction of acetone and acidified potassium dichromate?
acetone does not react with potassium dichromate
Chemical formula for ammonia and vinegar?
The chemical formula for ammonia is NH3 and for vinegar (acetic acid) is CH3COOH.
What is the chemical reaction between sodium acetate and sodium hydroxide?
When sodium acetate reacts with sodium hydroxide, a double displacement reaction occurs. The products of the reaction are sodium hydroxide and sodium acetate. The balanced chemical equation for this reaction is: CH3COONa + NaOH → CH3COONa + NaOH
What is another term for chemical change?
A chemical change is also referred to as a chemical reaction. It typically involves the transformation of substances into new substances with different chemical compositions.
What is the chemical reaction when the egg shell is soaked in vinegar?
The reaction is:CaCO3 + 2 CH3COOH = (CH3COO)2Ca + H2O + CO2
What is the chemical reaction when baking soda is mixed with vinegar?
CH3COOH + NaHCO3 = CH3COONa + CO2 + H2O
What causes the chemical reaction of calcium carbonate in an egg and acetic acid?
The reaction is:CaCO3 + 2 CH3COOH = (CH3COO)2Ca + H2O + CO2
What is the equatio of ZnO and CH3COOH?
The reaction between zinc oxide (ZnO) and acetic acid (CH3COOH) results in the formation of zinc acetate and water. The balanced chemical equation for this reaction is: ZnO + 2CH3COOH -> Zn(CH3COO)2 + H2O
What is the balanced equation for the reaction of phosphoric acid and acetic acid?
There is no reaction. Two acids cannot react with each other.
What is the chemical symbol for vinegar?
carbon oxygen hydrogen = CH3COOH is the thingy for vinegar
Acetic acid chemical formula?
CH3COOH is the chemical formula for acetic acid.
Write the balanced equation for the reaction of acetic acid CH3COOH and sodium bicarbonate NaHCO3 What type of reaction took place?
The balanced chemical equation for the reaction is: CH3COOH + NaHCO3 → CH3COONa + H2O + CO2 This is a double displacement reaction, where sodium from sodium bicarbonate replaces hydrogen in acetic acid to form sodium acetate, water, and carbon dioxide.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the chemical equation for the reaction of acetic acid and potassium hydroxide?
The chemical equation for the reaction between acetic acid (CH3COOH) and potassium hydroxide (KOH) is: CH3COOH + KOH -> CH3COOK + H2O. This reaction is a neutralization reaction that forms potassium acetate (CH3COOK) and water (H2O).
A vinegar has a sour taste is a Physical property Or Chemical Property?
The reaction between vinegar (acetic acid) and baking soda (sodium bicarbonate) is a chemical reaction (property). CH3COOH + NaHCO3 ==> CH3COONa + CO2(g) + H2O
How can reaction with ammonium acetate from acetic acid?
An example:HCl + NH4OH----------------NH4Cl + H2O
