0
Not particularly. It's shampoo. It's mildly irritating to the skin (generally not a problem as long as you rinse it off in a reasonable time as opposed to soaking in it for hours), somewhat more so to the eyes. Don't drink it, don't pour it into your eyes, don't walk around for hours at a time with shampoo in your hair. Note: ammonium lauryl sulfate is a different compound that is more likely to cause skin and eye irritation, though even that is still fairly innocuous when used properly.
What else can I help you with?
What is the chemical formula for Ammonium Laureth Sulfate?
The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.
Anion for ammonium sulfate?
The anion for ammonium sulfate is sulfate (SO4^2-). Ammonium sulfate is a salt that consists of the ammonium cation (NH4^+) and the sulfate anion.
Is ammonium sulfate polar?
Yes Ammonium sulfate is soluble in water because it is an ionic compound of ammonium ions and sulfate.
What is the percent of sulfur in ammonium sulfate?
it so very easy you can answer that joke the answer is percent of sulfur in ammonium sulfate
The formula for ammonium sulfate is?
The formula for ammonium sulfate is (NH4)2SO4, which represents two ammonium ions (NH4+) and one sulfate ion (SO4^2-).
What is the chemical formula for Ammonium Laureth Sulfate?
The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.
Is sodium laureth sulfate considered a sulfate?
Yes, sodium laureth sulfate is considered a sulfate.
Is sodium laureth sulfate the same as sodium lauryl sulfate?
No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Is sodium lauryl sulfate the same as sodium laureth sulfate?
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. Sodium lauryl sulfate is a harsher cleansing agent, while sodium laureth sulfate is milder and less irritating to the skin.
Are sodium lauryl sulfate and sodium laureth sulfate the same?
No, sodium lauryl sulfate and sodium laureth sulfate are not the same. While they are both surfactants commonly found in personal care products, sodium laureth sulfate is considered to be milder and less irritating than sodium lauryl sulfate.
What does suave shampoo have in it?
shampoo and Sodium Lauryl Sulfate Ammonium Lauryl Sulfate Ammonium Laureth Sulfate Ammonium Xylene Sulfonate TEA Lauryl Sulfate Sulfur (in dandruff shampoos) Selenium Sulfide (in dandruff shampoos) Balm Mint Balsam Certain Essential Oils Eucalyptus Grapefruit Horseradish Lavender Oil Lemon Lime Menthol Orange Papaya Peppermint Rose Sage Thyme
Anion for ammonium sulfate?
The anion for ammonium sulfate is sulfate (SO4^2-). Ammonium sulfate is a salt that consists of the ammonium cation (NH4^+) and the sulfate anion.
How much sodium laureth sulfate does tide have?
Tide laundry detergent contains approximately 10-15% Sodium Laureth Sulfate (SLES) as one of its surfactants.
What is the difference between sodium laureth sulfate and sodium lauryl sulfate?
Sodium laureth sulfate and sodium lauryl sulfate are both surfactants commonly used in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher surfactant that can be more irritating to the skin, while sodium laureth sulfate is milder and less likely to cause irritation.
What does abbreviation SLS stand for?
sodium laureth sulfate
What is the difference between sodium lauryl sulfate and sodium laureth sulfate?
Sodium lauryl sulfate and sodium laureth sulfate are both surfactants commonly found in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher cleansing agent that can be drying to the skin, while sodium laureth sulfate is a milder surfactant that is often preferred for sensitive skin.
