answersLogoWhite

0

Not particularly. It's shampoo. It's mildly irritating to the skin (generally not a problem as long as you rinse it off in a reasonable time as opposed to soaking in it for hours), somewhat more so to the eyes. Don't drink it, don't pour it into your eyes, don't walk around for hours at a time with shampoo in your hair. Note: ammonium lauryl sulfate is a different compound that is more likely to cause skin and eye irritation, though even that is still fairly innocuous when used properly.

User Avatar

Wiki User

16y ago

What else can I help you with?

Related Questions

What is the chemical formula for Ammonium Laureth Sulfate?

The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.


Is sodium laureth sulfate considered a sulfate?

Yes, sodium laureth sulfate is considered a sulfate.


What is the common name of Sodium Laureth Ether Sulphate?

it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be


Is sodium laureth sulfate the same as sodium lauryl sulfate?

No, sodium laureth sulfate and sodium lauryl sulfate are not the same. Sodium laureth sulfate is a milder surfactant compared to sodium lauryl sulfate, which can be harsher on the skin.


Is sodium lauryl sulfate the same as sodium laureth sulfate?

No, sodium lauryl sulfate and sodium laureth sulfate are not the same. Sodium lauryl sulfate is a harsher cleansing agent, while sodium laureth sulfate is milder and less irritating to the skin.


What does suave shampoo have in it?

shampoo and Sodium Lauryl Sulfate Ammonium Lauryl Sulfate Ammonium Laureth Sulfate Ammonium Xylene Sulfonate TEA Lauryl Sulfate Sulfur (in dandruff shampoos) Selenium Sulfide (in dandruff shampoos) Balm Mint Balsam Certain Essential Oils Eucalyptus Grapefruit Horseradish Lavender Oil Lemon Lime Menthol Orange Papaya Peppermint Rose Sage Thyme


Are sodium lauryl sulfate and sodium laureth sulfate the same?

No, sodium lauryl sulfate and sodium laureth sulfate are not the same. While they are both surfactants commonly found in personal care products, sodium laureth sulfate is considered to be milder and less irritating than sodium lauryl sulfate.


Anion for ammonium sulfate?

The anion for ammonium sulfate is sulfate (SO4^2-). Ammonium sulfate is a salt that consists of the ammonium cation (NH4^+) and the sulfate anion.


How much sodium laureth sulfate does tide have?

Tide laundry detergent contains approximately 10-15% Sodium Laureth Sulfate (SLES) as one of its surfactants.


What is the difference between sodium laureth sulfate and sodium lauryl sulfate?

Sodium laureth sulfate and sodium lauryl sulfate are both surfactants commonly used in personal care products. The main difference between them is in their chemical structure. Sodium lauryl sulfate is a harsher surfactant that can be more irritating to the skin, while sodium laureth sulfate is milder and less likely to cause irritation.


What does abbreviation SLS stand for?

sodium laureth sulfate


What is the ingredients in Head and Shoulders shampoo?

The ingredient list says Pyrithione zinc, water, sodium laureth sulfate, sodium lauryl sulfate, cocamide MEA, zinc carbonate, glycol distearate, dimethicone, fragrance, cetyl alcohol, guar hydroxypropyltrimonium chloride, magnesium sulfate, sodium benzoate, magnesium carbonate hydroxide, ammonium laureth sulfate, benzyl alcohol, sodium chloride, methylchloroisothiazolinone, methylisothiazolinone, sodium xylenesulfonate, blue 1, red 4.