0
Sodium acetate, or Sodium ethanoate, is an ionic substance, which means that the positively-charged Sodium ion and the negatively-charged ethanoate ion are held together by strong electrostatic forces. So, at room temperature, sodium acetate is a solid.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Sodium acetate gas?
No, sodium acetate is a solid under normal conditions.
Zinc acetate react with sodium phosphate?
sodium acetate and zinc phosphate
What is the name for the chemical formula NaOCOCH3?
Sodium acetate or Sodium ethanoate
How many formula units of sodium acetate are in 0.87 moles of sodium acetate?
How many formula units of sodium acetate are in 0.87 moles of sodium acetat
Is the reaction between Sodium acetate and water a chemical reaction?
No, it is simply the water dissolving the sodium acetate, which is a physical change. There is a physical change when you introduce a seed crystal to the sodium acetate as the bonds in the chemical become different to form a solid. By adding water, you are just dissolving it and then allowing it to become supersaturated through heating.
Sodium acetate gas?
No, sodium acetate is a solid under normal conditions.
What is the formula of the solid reactant of sodium carbonate and acetic acid?
Sodium carbonate is a solid reactant. It will form sodium acetate and carbon dioxide with acetic acid. The formual for the solid product sodium acetate is CH3COONa.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
After mixing baking soda and vinegar we produce sodium acetate plus water plus carbon dioxide What state of matter is the sodium acetate at this point?
solid
Is sodium acetate solution a metal?
No. Sodium acetate solution is a homogeneous mixture, which is a solution. Sodium acetate is an ionic compound formed from sodium ions and acetate ions. Sodium in sodium acetate no longer has the properties of sodium metal.
Is sodium acetate an element a compound or a mixture?
Sodium acetate is a compound. Generally, when the name of a substance contains two or more words (unless one of them is solid, liquid, gas, or metal), it is not an element.
Zinc acetate react with sodium phosphate?
sodium acetate and zinc phosphate
What is the regular name of sodium acetate?
Sodium acetate or sodium ethanoate or E262.
How is dry ice formed when sodium acetate is added to water?
Dry ice is not formed in this instance.Dry ice is solid carbon dioxide. The phenomenon involving sodium acetate is colloquially called hot ice. Simply adding sodium acetate to water will not produce this. You need to create a supersaturated solution. You add sodium acetate to water untill it cannot dissolve any more, and then cool the solution. Now you have an unstable solution that has more dissolved sodium acetate than it could normally hold. If it is disturbed, the sodium acetate will sponaneously crystallize.
What is the name for the chemical formula NaOCOCH3?
Sodium acetate or Sodium ethanoate
Why does soduim ascetate turn into ice?
Firstly, when sodium acetate (CH3COONa) solidifies, it does not form "ice". It just becomes solid. This happens when the sodium acetate is heated to about 100oC, then cooled below its freezing point. When a foreign substance with the same crystal structure as sodium acetate is introduced, or a nucleation centre is provided, the sodium acetate will warm up to its freezing point and freeze at its (supposed to be) freezing point.
How many formula units of sodium acetate are in 0.87 moles of sodium acetate?
How many formula units of sodium acetate are in 0.87 moles of sodium acetat
