0
What else can I help you with?
What is the balanced equation of perchloric acid and sodium hydroxide?
Perchloric acid is a strong acid. Sodium hydroxide is a strong base. HClO4(aq) + NaOH(aq) ---> Na+(aq) + ClO4-(aq) + H2O(l) This is a balanced chmical reaction since the products and reacts have a 1:1 ratio.
What is the product and balanced equation of C8H5O4K NaOH?
The reaction between C8H5O4K and NaOH will produce potassium salicylate (C7H5KO3) and water. The balanced equation is: C8H5O4K + NaOH → C7H5KO3 + H2O.
Balanced reaction of ethyl acetate and NaoH?
NaOH+H3COOC2H5 --> CH3COONA+C2H5OHTo make the components more clear.(Na-OH)+(H3COO-C2H5) --> (CH3COO-NA)+(C2H5-OH)
What is balanced chemical equation for reaction between naoh plus ch3cooh?
NaOH + CH3COOH = CH3COONa + H2O Good Luck !
How do you balance the equation between propionic acid and sodium hydroxide?
To balance the equation between propionic acid (C3H6O2) and sodium hydroxide (NaOH), you need to form water (H2O) and sodium propionate (C3H5NaO2). The balanced equation is: C3H6O2 + NaOH -> H2O + C3H5NaO2. This equation is already balanced because there is an equal number of each type of atom on both sides of the equation.
What is the balanced equation of perchloric acid and sodium hydroxide?
Perchloric acid is a strong acid. Sodium hydroxide is a strong base. HClO4(aq) + NaOH(aq) ---> Na+(aq) + ClO4-(aq) + H2O(l) This is a balanced chmical reaction since the products and reacts have a 1:1 ratio.
What is the balanced equation for C6H8O7H2O and NaOH?
The chemical equation is:C6H8O7 + 3 NaOH = C6H5O7Na3 + 3 H2O
Balancing a chemical equation is a example of?
An example of a balanced chemical equation is: NaOH + HCl = NaCl + H2O
What is the balanced chemical equation of NaOH and tartaric acid?
The balanced chemical equation for the reaction between NaOH (sodium hydroxide) and tartaric acid (C4H6O6) is: 2NaOH + H2C4H4O6 -> 2H2O + Na2C4H4O6
What is the balanced chemical equation for ammonium nitrate and sodium hydroxide?
The balanced chemical equation for the reaction between ammonium nitrate (NH4NO3) and sodium hydroxide (NaOH) is: NH4NO3 + NaOH -> NH3 + H2O + NaNO3
What is an ionic equation for HClO4(aq) NaOH(aq) -- and gt H2O (l) plus NaClO4(aq).?
HClO4(aq) + NaOH(aq) → H2O(l) + NaClO4(aq) Ionic Equation: H+ + ClO4- + Na+ + OH- → H2O + Na+ + ClO4-
What is the balanced equation for hydrchloric and sodium hydroxide?
HCl + NaOH -> NaCl + H2O This is a balanced chemical equation representing the reaction between hydrochloric acid (HCl) and sodium hydroxide (NaOH) to form sodium chloride (NaCl) and water (H2O).
Balanced equation of HCH3COO NaOH?
The balanced equation for the reaction between acetic acid (HC2H3O2) and sodium hydroxide (NaOH) is: HC2H3O2 + NaOH → NaC2H3O2 + H2O
What is the ratio of moles of CuSO4 to moles of NaOH?
This ratio is 1:2.
What is the product of the chemical equation NaOH C6H12O6 O2?
The product of the chemical equation is water (H2O) and sodium carbonate (Na2CO3). The balanced chemical equation for the reaction is: 2NaOH + C6H12O6 + 3O2 -> 2Na2CO3 + 3H2O.
What is the a balanced equition between ch3ooh and naoh?
CH3COOH + NaOH --> CH3COONa + H2OOr better the ionic equation in water:CH3COOH + OH- --> CH3COO- + H2O[Na+ ions are left out of the equation because they don't take part in this reaction: it stays unchanged in solution]
What is the balanced equation for sodium hydroxide ammonium nitrate?
The chemical reaction is: NH4NO3 + NaOH ---------→ NH3 + H2O + NaNO3
