4 HCl + 2 NaClO = 2 Na + 2 H2O + 3 Cl2
Perchloric acid is a strong acid. Sodium hydroxide is a strong base. HClO4(aq) + NaOH(aq) ---> Na+(aq) + ClO4-(aq) + H2O(l) This is a balanced chmical reaction since the products and reacts have a 1:1 ratio.
The reaction between C8H5O4K and NaOH will produce potassium salicylate (C7H5KO3) and water. The balanced equation is: C8H5O4K + NaOH → C7H5KO3 + H2O.
NaOH+H3COOC2H5 --> CH3COONA+C2H5OHTo make the components more clear.(Na-OH)+(H3COO-C2H5) --> (CH3COO-NA)+(C2H5-OH)
NaOH + CH3COOH = CH3COONa + H2O Good Luck !
To balance the equation between propionic acid (C3H6O2) and sodium hydroxide (NaOH), you need to form water (H2O) and sodium propionate (C3H5NaO2). The balanced equation is: C3H6O2 + NaOH -> H2O + C3H5NaO2. This equation is already balanced because there is an equal number of each type of atom on both sides of the equation.
Perchloric acid is a strong acid. Sodium hydroxide is a strong base. HClO4(aq) + NaOH(aq) ---> Na+(aq) + ClO4-(aq) + H2O(l) This is a balanced chmical reaction since the products and reacts have a 1:1 ratio.
The chemical equation is:C6H8O7 + 3 NaOH = C6H5O7Na3 + 3 H2O
An example of a balanced chemical equation is: NaOH + HCl = NaCl + H2O
The balanced chemical equation for the reaction between NaOH (sodium hydroxide) and tartaric acid (C4H6O6) is: 2NaOH + H2C4H4O6 -> 2H2O + Na2C4H4O6
The balanced chemical equation for the reaction between ammonium nitrate (NH4NO3) and sodium hydroxide (NaOH) is: NH4NO3 + NaOH -> NH3 + H2O + NaNO3
HClO4(aq) + NaOH(aq) → H2O(l) + NaClO4(aq) Ionic Equation: H+ + ClO4- + Na+ + OH- → H2O + Na+ + ClO4-
HCl + NaOH -> NaCl + H2O This is a balanced chemical equation representing the reaction between hydrochloric acid (HCl) and sodium hydroxide (NaOH) to form sodium chloride (NaCl) and water (H2O).
The balanced equation for the reaction between acetic acid (HC2H3O2) and sodium hydroxide (NaOH) is: HC2H3O2 + NaOH → NaC2H3O2 + H2O
This ratio is 1:2.
The product of the chemical equation is water (H2O) and sodium carbonate (Na2CO3). The balanced chemical equation for the reaction is: 2NaOH + C6H12O6 + 3O2 -> 2Na2CO3 + 3H2O.
CH3COOH + NaOH --> CH3COONa + H2OOr better the ionic equation in water:CH3COOH + OH- --> CH3COO- + H2O[Na+ ions are left out of the equation because they don't take part in this reaction: it stays unchanged in solution]
The chemical reaction is: NH4NO3 + NaOH ---------→ NH3 + H2O + NaNO3