0
What else can I help you with?
What is the balance equation for NaCl plus BaCl2?
This equation does not balance because 2 chlorine salts do not react with eachother. However, they are both highly soluable in water. By adding H2O, this equation can be balanced.
Gold III nitrate?
Gold(III) nitrate is a chemical compound with the formula Au(NO3)3. It is a yellow, crystalline solid that is highly toxic and can decompose explosively when heated. Gold(III) nitrate is primarily used in research laboratories for various chemical reactions and is not commonly found in commercial applications.
What is the chemical formula for nickel3 oxalate?
The chemical formula for nickel(III) oxalate is Ni2(C2O4)3.
What is made when silver nitrate react with calcium chloride?
silver nitrate (AgNO3) is an ionic compound and so does calcium chloride (CaCl2). Two ionic compounds react to produce two salts. This is called changing ions because Ag receives Cl now instead of NO3 and Ca receives NO3. Therefore, AgNO3 + CaCl2 = AgCl + Ca(NO3)2. A rule is present that Nitrate is soluble (it dissolves in H2O). Meanwhile, both, Cl and Ag are insoluble, therefore a solid we call as precipitate will settle to the bottom. this precipitate is AgCl (solid). All in all this reaction is called the precipitation reaction.
What is the reaction that takes place when copper is in silver nitrate solution?
The result is a clear blue liquid that reflectes light off it. I don't much about it and I'm looking on the internet to get a better understanding of it. But, it was during a school experiment and this is what me and my partner discovered.
When this equation is balanced what is the coefficient for ni (no.3) 3?
The coefficient for Ni NO3 3 is four.
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the coefficient for Ni No3 3?
4
What is the coefficient for ni (no3)4?
4
Nickel reacts with lead nitrate to produce nickel nitrate and lead unbalanced equation?
The unbalanced equation for the reaction is: Ni + Pb(NO3)2 -> Ni(NO3)2 + Pb
What is the chemical equation for magnesium metal and nickel nitrate?
Magnesium is not polyvalent so you do not need to specify Magnesium 2 or II.The formula for magnesium nitrate is Mg(NO3)2If you had intended to ask the formula for manganese (II) nitrate, it is Mn(NO3)2
When balancing equations should you adjust the subscripts or the coefficients?
Subscripts state how many atoms and Coefficients state how many molecules there are. So when balancing an equation you always adjust the coefficients. When this equation is balanced, what is the coefficient for Ni(NOËÄ)ËÄ? 4
What is the chemical reaction between nickel (ii) nitrate and sodium hydroxide?
The chemical reaction between nickel(II) nitrate (Ni(NO3)2) and sodium hydroxide (NaOH) produces nickel hydroxide (Ni(OH)2) and sodium nitrate (NaNO3) in a double displacement reaction. The balanced chemical equation is: Ni(NO3)2 + 2NaOH → Ni(OH)2 + 2NaNO3.
What is the balanced equation for chromium III bromide and sodium nitrate?
An example of a balanced chemical equation for chromium and nickel sulfate appears below.Cr(s) + NiSO4(aq) � Cr2(SO4)3 + Ni(s
What is the formula for nickel I nitrite?
Ni+1 NO2-1
What is the balanced chemical equation for nickel ii sulphate and disodium salt of edta?
NiSO4 + Na2(edta) -----> Ni(edta) + Na2SO4
