0
Natural gas comes out of the ground. As a product of nature, natural gas is not the same from country to country. Methane is the main component, but metane's percentage can vary between 80% and 95%. Others hydrocarbons' percentage (for example ethane, propane, butane etc) also vary. Since heating value depends on the percentage of the hydrocarbons, heating value also varies.
What else can I help you with?
What is the calorific value of NGL?
The calorific value of Natural Gas Liquids (NGL) varies depending on the specific composition, but it typically ranges from about 1,500 to 1,800 British thermal units (BTUs) per pound. This value can fluctuate based on the proportions of components like ethane, propane, butane, and natural gasoline. Generally, NGLs have a higher calorific value compared to raw natural gas, making them valuable as fuel and feedstock in various industries.
What is the best value of coefficient of performance?
Well, conceptually, the best value for COP would be infinite because we'd like to be able to provide the largest amount of heating or cooling for the smallest amount of input energy.
What must be the slump value for different grade of concrete?
what is the slump value for M20 concrete
Are resistor heating affected by line frequency?
No. The heating effect is the product of the square of the current and resistance, where the current is a root-mean-square value.A.C. current is always expressed as a root-mean-square (r.m.s.) value, which is equivalent to a d.c. current which produces exactly the same heating effect. Root-mean-square values are affected by the shape of a waveform, but not by its frequency.
Why is the theoretical value for modulus of elastricity for mild steel is different from the calculated value?
because it is the ratio of the stress to the strain and in actual condition the strain developed is different from the theoretical .
How many cubic feet of natural gas to equate to 1 gallon per minute of heating oil?
It will vary somewhat with the composition of the natural gas, but roughly 133 cubic ft of natural gas has the same heat value as 1 gallon of #2 heating oil. Minutes do not enter into the calculation
How do you calculate heating value of natural gas?
The net heating value will considering the evaporation of water formed in reaction of natural gas decomposition as follow CnHm+(n+m/4)O2=nO2+m/2H2O For Methane : CH4 we have n=1 " number of carbon m=4 " number of hydrogen then: CH4+(1+4/2)O2 O2+2H2O=CH4+3O2=2H2O Subtracting enthalpy of products from reactants to get enthalpy of decomposition
What way would cash flows differ in different countries?
The cash flow is different in different countries because of the econmoy. Depending the value of the currency some countries would greater cash flow compare to poor countries.
What is the calorific value of diesel fuel?
When we are making a thermodynamic analysis of a system where diesel fuel is combusted we use the heating value of the fuel. You must determine whether you should use the higher heating value (HHV), or lower heating value (LHV), based on the application. Hope this helps.
What is the heating value of diesel fuel?
Lower Heating Value (LHV) MJ/kg = 43.4 Higher Heating Value (HHV) MJ/kg = 46.5
Why currency value of different country is different?
The values of currencies are based on that country's economic strength. Goods do not have the same value across multiple countries.
How many countries use pesos as a national currency?
There a few countries that use "pesos" but they're all of different value.
What burns hotter oil or natural gas?
Natural gas burns hotter than oil. Natural gas has a higher heating value per unit volume compared to oil, making it a more efficient and hotter-burning fuel.
How do you find heating value of natural gas?
about 1,000 BTU/ft3. See related link. It is not exact because natural gas composition varies. A richer gas would have a higher heating value. The cubic feet (ft3) is often abbreviated scf, or standard cubic feet, measured at 60 deg F and 14.7 psia. Future market gas prices at quoted in $/mmBTU or dollars per million BTU (currently around $4/mmBTU), equivalent to $4.00/Mscf. See related site.
Currency differences in north and south?
Money is the same in both the North and the South. In different countries the money value is different.
Why is there a difference in currency value between different countries?
Because the value of each currency is based on their economic strength. Currency is traded between countries - and one currency may be in more demand (increasing its value) than another.
How much natural gas is required to produce 1 ton of steam?
On average, about 1050 cubic feet of natural gas is required to produce 1 ton of steam. This can vary depending on the efficiency of the boiler and the heating value of the natural gas being used.
