0
What else can I help you with?
What are artificial smells?
Artificial smells are made just like any fake smell, with chemicals or some kind of extract. I hope this was useful!
What conditions can produce hydrolysis of an ester?
Either an acidic of basic condition can produce hydrolysis of an ester. An ester is derived from an alcohol and a carboxylic acid.
Is the ester in nail varnish remover a solution?
The ester in a nail varnish is a good solvent that is used in nail polish removers because it dissolves the nail varnish and does not affect the nail.
What cologne smells like jade east cologne?
Jade East does. It's typically difficult even for experts to differentiate between them.
Can you give an five example of observation?
I see candy.The candy is sticky to the touch.The candy smells like strawberries.The candy tastes like kiwis.I hear my chewing of the candy.
What esters smells like banana?
Banana popsickle ester, this is the ester that is use in banana liqueur
What ester smells like peaches?
Benzyl Acetate.Source: Macroscale and Microscale Organic Experiments (6th ed) by Williamson, p. 516.
Give examples for esters?
Some common examples of esters include ethyl acetate (smells like nail polish remover), methyl salicylate (smells like wintergreen), and isoamyl acetate (smells like bananas). Esters are commonly used as fragrances and flavorings in perfumes, cosmetics, and food products.
Is methyl benzoate an ester?
Methyl benzoate, an organic compound, is an ester. It is a colorless liquid that is not soluble in water and has a fruity smells. Some uses for methyl benzoate are as a solvent and a pesticide.
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
There is an acid that smells like sweaty socks. When alcohol is added to it and the mixture is heated no change is visible but a new odor of sweet apples fills the room. Which of the following is the?
The acid that smells like sweaty socks is likely butyric acid. When alcohol is added and the mixture is heated, esterification may occur, forming an ester that smells like sweet apples. This process involves the reaction between the acid and alcohol to produce the fruity odor.
What does apricot taste like?
Yes
What parts of the apricot tree are used for medicinal purposes?
Apricot seed is the small kernel enclosed within the wood-like pit at the center of the apricot fruit.
Shelley smells like eggshells?
its true cos she smells like eggshells!!!!!!!!! its true cos she smells like eggshells!!!!!!!!!
What ester is formed when formic acid reacts with isobutyl alcohol?
Isobutyl formate is formed when formic acid reacts with isobutyl alcohol.
How does grass smells like?
It smells foul
What is an apricot blossom?
An apricot blossom is a flower of an apricot tree which will eventually turn into an apricot.
