0
What else can I help you with?
Is stearic acid and stearoyl CoA the same thing?
Stearic acid is a saturated fatty acid 18 carbons long. Stearoyl CoA is a molecule of stearic acid bound to the molecule coenzyme A (CoA), which occurs during the metabolism of stearic acid to release energy, so they are not the same thing.
Which substance has a stronger inter molecular force stearic acid or melting temp of water?
Stearic acid since it is nonpolar and H2O is polar.
Equation of saponification using oleopalmitostearin as triglyceride?
CH2OCO(CH2)7CH=CH(CH2)7CH3 CH2OH CH3(CH2)7CH=CH(CH2)7COONa | | + CHOCO(CH12)12CH3 + 3NaOH ---> CHOH + CH3(CH2)14COONa | | + CH2OCO(CH2)16CH3 CH2OH CH3(CH2)16COONa
What is C18 H34 O3?
C18 H34 O3 is the chemical formula for stearic acid. It is a saturated fatty acid commonly found in animal and vegetable fats. Stearic acid is used in various industrial applications, such as in the production of cosmetics, candles, and soaps.
What combination of atoms makes the molecule of stearic acid an acid?
The acidic nature of stearic acid is due to the presence of a carboxylic acid functional group (-COOH). This group is composed of one carbon atom, one oxygen atom, and one hydrogen atom. The hydrogen atom within the carboxylic acid group can ionize to release a proton, leading to its acidic behavior.
How do you calculate saponification number in fat acid containing palmitoleic stearic and butyric acid?
emad abdelhalim
What acid is in soap?
Soap often contains fatty acids such as oleic acid, palmitic acid, and stearic acid. These acids are the result of the saponification process, where fats and oils are combined with sodium hydroxide (lye) to produce soap.
What is the equation for the preparation of soap from stearic acid and sodium hydroxide?
Well, to write it out is complex, but I will do my best: C18H36O2 + NaOH = alcohol + salt of the carboxylic acid (soap) The proper name for this process saponification, and the specific products can be determined via GC analysis or through your own tedious calculations.
Chmical reaction when stearic acid add KOH?
When stearic acid is added to potassium hydroxide (KOH), it undergoes saponification to form potassium stearate and water. This reaction is commonly used in soap making processes. The reaction can be represented by the chemical equation: C17H35COOH + KOH -> C17H35COOK + H2O
Which acid is more strong stearic acid or citric acid?
stearic acid is more strong i think so..........
Does stearic acid contain pork?
stearic acid can come from pork. It is a fatty acid that is used in cosmetics.
Is stearic acid vegetarian?
Stearic acid can be vegetable and animal derived, or it can be made synthetically.
Can stearic acid be solid?
Yes. Stearic acid is normally a solid, and it melts at around 70ºC
How do you separate stearic acid from sand and zinc?
Add water and stir; the density of the stearic acid is very low - 0,843 g/cm3; consequently this insoluble in water acid float. Zinc and sand sits at the bottom of the beaker and the stearic acid can be separated.
Can stearic acid cause prostate roblems in men?
Stearic acid does not cause prostate problems in men. In some studies, stearic acid has been shown to decrease metastatic prostate cancer by 70%.
How do you prove that glucose do not raise the melting point of stearic acid?
To prove that glucose does not raise the melting point of stearic acid, conduct a melting point analysis of stearic acid alone and stearic acid mixed with glucose. If the melting point of the mixture is the same as that of stearic acid alone, it indicates that the presence of glucose does not affect the melting point of stearic acid. This experiment can help demonstrate that glucose does not raise the melting point of stearic acid.
What is the solubility of stearic acid in acetone?
please I need to prepper shower gel so, i need to use stearic acid but how ican dissolve and the percenatge ican use thank you
