answersLogoWhite

0

The molecular structure you provided corresponds to an amino acid known as aspartic acid (Asp). Its chemical formula is C4H7NO4, featuring an amino group (NH2), a carboxyl group (COOH), and a side chain that includes another carboxyl group. Aspartic acid is one of the 20 standard amino acids used by cells to synthesize proteins and plays a key role in metabolism and neurotransmission. The structure indicates the presence of both acidic and basic functional groups, which contribute to its properties in biological systems.

User Avatar

AnswerBot

6mo ago

What else can I help you with?

Related Questions

What is the molecular formula of CTAB?

[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide


What are the different types of organic reaction?

Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.


What is the Lewis dot structure of butane?

There are a two different forms of butane, depending on how the atoms are connected. All have 4 carbon and 10 hydrogen atoms, but one is a linear structure (called n-butane), another is branched once (called isobutane). See the Related Questions for how to draw the Lewis dot structure, but the atoms are connected as follows: n-butane: H3C-CH2-CH2-CH3 isobutane (CH3)3CH


What is KB for ch3 3n aq h2o l ch3 3nh aq oh-aq?

Kb=[(Ch3)3 NH+][OH-] __________ [(Ch3)3 N]


What formula is represents an amino acid?

H2N-CHR-COOH Structure: H H O | | N - C - C | | | H R OH


What formula represents amino acids?

H2N-CHR-COOH Structure: H H O | | N - C - C | | | H R OH


What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?

The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.


What is the chemical formula for sodium myristoyl sarcosinate?

Chemical formula of sodium myristoyl sarcosinate is:CH3(CH2)12CO--N(CH3)CH2COONaIt is myristic acid (butadecanoic acid, CH3(CH2)12CO-OH) coupled to the amino group of methyl-glycine (methyl-aminoethanoate, H-N(CH3)CH2COO- ) by a peptide bond (carbonyl to amino)The more official chemical name is, from this the structural formula can be formulated unambigiously according to IUPAC-rules:sodium N-methyl-N-(1-oxotetradecyl)aminoacetateThere is more information from ChemNet is in 'Related links', just below this answer.


What is the chemical formula of rubber.?

[CH2=C(CH3)CH-CH2-] n approximately where n is > 250 usually but also [-----CH2-CH(CH3)CH-CH2-] n etc BASICALLY ISOPRENE CH2=C(CH3)CH=CH2 polymerized


What is C2H6 called?

C2H6 is called ethane. It is a hydrocarbon compound consisting of two carbon atoms and six hydrogen atoms.


How many isomers of C8H10 are there?

Butane C4H10 has 2 isomersbutane C-C-C-C (n-butane)2-methyl propane CH3)2-CH-CH3 (isobutane)


Which molecules contains a triple covalent bonds?

All ALK**Y**NES e.g. Eth**y**ne( Acetylene) ; H-C///C-H Prop**y**ne ; H-C///C-CH3 et seq., Also But-1,3-diyne ; H-C///C-C///C-H et seq., Also Nitriles(Cyanides) . The anion is ' -C///N(^-) '. e.g. Potassium cyanide ; K-C///N NB . ///. is to represent a triple bond.