0
The base dissociation constant (Kb) for methylamine (CH3NH2) can be determined from its equilibrium reaction with water, where CH3NH2 accepts a proton to form CH3NH3+ and hydroxide ions (OH-). The Kb value indicates the strength of CH3NH2 as a base, reflecting its ability to generate OH- in solution. For methylamine, Kb is approximately 4.2 × 10^-4, highlighting its moderate basicity. This value can be used in calculations involving the concentration of hydroxide ions produced in a solution of methylamine.
What else can I help you with?
What type of reaction is Al plus 3Hg(CH3)2 yields Al(CH3) plus 3Hg?
This reaction is called "metal-metal exchange reaction".
CH3 plus CH3CH2OH what is the expected product?
The reaction between CH3 and CH3CH2OH (ethanol) is a radical substitution reaction. The expected product would be ethane (CH3CH3) and a ethoxy radical (CH3CH2O•).
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What is the shape bond angle and hybridization of plus CH3?
CH3 is a trigonal planar and has a hybridization of sp3
Is Al plus 3Hg(CH3)2 yields Al(CH3)3 plus 3Hg a precipitation reaction?
Trimethyl aluminium is not a solid precipitate.
What is the molecular geometry of CH3 plus?
Trigonal Planar
What is the electron geometry of CH3 plus?
Trigonal Planar
What type of reaction is Al plus 3Hg(CH3)2 yields Al(CH3) plus 3Hg?
This reaction is called "metal-metal exchange reaction".
CH3 plus CH3CH2OH what is the expected product?
The reaction between CH3 and CH3CH2OH (ethanol) is a radical substitution reaction. The expected product would be ethane (CH3CH3) and a ethoxy radical (CH3CH2O•).
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What is the extended structural formula of 2-methyl propane?
Difficult to draw here, but let's try to describe: Three methyl groups (CH3-) and one H- atom bonded to one central C atom, then you'll get something like this: . . . .H CH3-C-CH3 . . . .CH3
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
