0
What else can I help you with?
How many moles are present in g of NiBr3(aq)?
To find the number of moles of NiBr3 in a given mass (g), you can use the formula: [ \text{moles} = \frac{\text{mass (g)}}{\text{molar mass (g/mol)}} ] First, calculate the molar mass of NiBr3 by adding the molar mass of nickel (approximately 58.69 g/mol) and three times the molar mass of bromine (approximately 79.90 g/mol). The total molar mass of NiBr3 is approximately 298.39 g/mol. Then divide the mass of NiBr3 by this molar mass to find the number of moles.
What is the formula for Ni positive 3 and Br negative 1?
NiBr3
What is the formula for copper II nitrate trihydrate?
The formula for copper II nitrate trihydrate is Cu(NO3)2•3H2O. This compound contains one copper atom (Cu), two nitrate ions (NO3), and three water molecules (H2O) in its structure.
How oxalic acid removes rust?
Rust is Fe2O3 ....it can not be removed by 1.HCl 2.H2So4 3.Edta..... but can remove by Oxalic Acid H2C2O4 Fe2O3(s) + 6 H2C2O4(aq) → 2 Fe(C2O4)3 3−(aq) + 3 H2O(l) + 6 H+(aq)
What is the coefficient number in a chemical formula?
A coefficient in a chemical formula tells you how many molecules there are. For example, 3Co2. The number 3 which comes before the C tells you that there are 3 molecules. The coefficient is the first number. This molecules consist of 3 C atoms (1 multiplied by the coefficient 3), and 6 O atoms( 2 multiplied by the coefficient 3) Another example: H= one hydrogen atom H2= one molecule made of 2 hydrogen atoms bonded together 3H20= three molecules consisting of two hydrogen atoms bonded to one oxygen atom
What is the of name NiBr3?
NiBr3 stands for nickel(III) bromide. It is a chemical compound composed of nickel and bromine, where nickel has an oxidation state of +3.
What is the formula for Ni positive 3 and Br negative 1?
NiBr3
What is the formula for copper nitrate trihydrate?
Cu(NO3)2 ・3H20
How long does it take to drive from Leuven to Charles de Gaulle airport?
About 3h20.
What is the reaction for anaerobic respiration?
c6H12O6 + 3hco3- + 3h+ >>> 6co2 + 3h20 + 3ch4
What is produced when iron reacts with water?
Iron oxide is produced.The chemical reaction is given as 2Fe+3H20=Fe2O3+3H2
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
How far is it from Paris to Mont St Michel?
the distance from Paris to the Mont-Saint-Michel is 358 km by the A13 motorway. The driving time is 3H20.
How do you say 3 20 in french?
3:20 --> 3h20 (or 18h20, if it's in the afternoon) --> trois heures vingt
What will be the product of the reaction of ethanol and NaOH and iodine?
The reaction of ethanol with NaOH and iodine will yield iodoethane (ethyl iodide) as the product. The alcohol group in ethanol will be replaced by the iodine atom in the presence of NaOH.
Which of the following combustion reactions is balanced correctly?
The correct answer is: C5H12 + 8O2 5CO2 + 6H2O.
