0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Which is the most important factor in determining where you live?
What is frontal executive dysfunction?
Which procces involves a prokaryotic cell living inside of a larger host prokaryotic cell?
Why does adding additional substrate overcome competitive but not noncompetitive inhibition?
Where can one purchase a Saturn hybrid?
What is inside of the plant cell that is not in the animal cell?
How many electron shells would you expect to find in a sulphur atom?
What term refers to incentive for a person to make money for himself?
Does Al have a larger atomic radius than B?
What glands produce a thicker type of sweat that contains more proteins and are mostly concentrated in areas of skin with course hair?
How was writing on wax an disadvantage?
Is flaxseed used to make isabgol?
Are bacteria found in humans?
How do people recover from thunderstorms?
What does the map show as a major disagreement left unresolved by the war?
How many significant figures are in 60800000?
What potential problem do you foresee?
What is the most Most valuable crystal in the world?
What is the difference between the cotyledons and the true leaves of flowering plants?
What is the missing molecule in Duchenne muscular dystrophy?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.