0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What are facts about Manam the volcano?
What colour does idoine go if there is no starch present in a food?
What type of root?
What planet is closest to Earth - Mars Neptune or Pluto?
Who are the Fastest ranking fastest race horses by speed?
Smell in my house from the oil burner It does not smell like fuel When you walk in the house it burns your nose and throat but it smells different than oil What could it be is it dangerous?
How can I hatch eggs at home without an incubator?
What does 3.5 equal in a fraction?
What is the community of living organisms and their abiotic or living environment called?
What is a calorific value?
What way do groups go on an periodic table?
How accurate is the human eye and is there anything more accurate?
What is every living entity made from?
What are animals that get hunted by predators called?
Why during fight or flight do your muscles become tense?
Why does your dryer keep tripping the circuit breaker?
What country is 8 square miles in area?
What three psychological needs dose food help meet?
What organelle contains genes?
What is boc gases and what do they do?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.