0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What does 2.1a max mean?
What is the time required for the earth to rotate once on its axis called?
What is the atomic number for butane?
How do you find distance with final velocity and minimum acceleration?
How does the motion of a plate produce a chain of islands?
What type of noun is the word fact?
What is the alpha star of cancer constellation?
What problems had cropped up because of damage to the ozone layer due to these gases?
What moves though oceans bringing warm or cool temperatures from other places?
Where do plant cells contain DNA?
What is the idea used to dispute the theory of plate tectonics?
What is a toxic preparation important as a germicide and local astringent?
What does auxin gibberellin and cytokinin have in common?
How many miles does your seat ibiza do to a liter?
What is lost when the monomers link together?
Why does grape juice clean pennies best?
When thermal energy moves out of a substance the temptarue will?
How many meters is 35 feet?
What are the causes of tailing in chromatography?
What is equal to half inch on the metric system?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.