0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What do barnacle fish eat?
Do neutrons differ in elements?
What steps to the water cycle lowest to highest?
Where did Dust Bowl farmers go?
How does measurements of carbon dioxide and temperature compare?
How can you tell how many times an atom will bond by?
What kind of mixture is table salt?
Where does Alpha Pavonis fall on the HR Diagram?
How does ragwort disperse?
What cities does the prime meridian pass directly through?
How is southern Africa like northern Africa?
What is the largest sink hole in the world?
What is the name of the fifth level of the energy pyramid?
Diameter in km of Saturn?
What would feeling like you have rocks under your feet indicate?
How old does a fly have to be to reproduce?
What kind of tectonic stress causes folded mountains?
What are the native animals of Utah?
Why Turn Back the Clock at 2 AM?
Does nitrogen help to grow plants w?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.