0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is 60 north and 110 east?
Example of electromagnetic radiation?
How do you know when to pick the buds?
What do organs consists of?
When DNA is combined from two different sources what kind of organism does it produce?
Once limiting factors cause a population to slow its growth a J curve changes into a?
What is the antonym of time?
Why does a leaf remove oxygen when submerged in water?
What can be used to measure 3.75 ounces?
What is the reaction of a non metal and a metal from opposite sides of the periodic table?
Which earth layer is made up of liquid rock?
It is important to protect wild animals like crocodiles?
How many gallons are in 48 oz?
Why it is necessary to give protection and support to unorganised sector workers?
What is the density of Cl2 gas at STP?
What are surface cells?
What is the connection between the adjacent neurons?
How do you convert millimeters to meters squared?
What is velocity of sound in 410 stainless steel?
What is the study of the vascular system called?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.