0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is a single kind of matter that has specific composition?
Why DNA replication needed a cell divides into two daughter cells?
What do polar head groups do?
What is the latitude and longitude for sheveluch russia?
Would a person freeze or burn on mercury?
What shape are owl's eyeballs?
What would two wires entering the service weatherhead indicate?
Is the blood brain barrier effective against glucose?
What cities are a deciduous forest biome?
What color flame do you get if you potassium burn?
What type of bonding happens to metalloids and metals and why?
What is the pressure of the upper mantle?
What part of the eye contains epithelial tissue?
How were nations like Spain Italy and Germany able to overcome tribal and clan conflicts over the centuries to become united countries?
What are latent prints?
How many joules of energy are necessary to heat the ice to 0 c?
Why diffusion is not an efficient means of transportation in higher organism?
Where is the hydrophilic portion of membrane?
What group is Uranium reactive to?
When a metal burns does it give off carbon dioxide?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.