0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is the spring climate like in iowa?
What is the largest variety of living organisms on earth is called?
Cut off list of Ruia Junior college Science?
Why must uranium be enriched?
Why are needleleaf trees also known as evergreen trees?
Is NAD an example of a coenzyme?
Why does microwave radiation damage your living tissue?
How many time zones will you cross in order to get to France?
What actually causes the deaths of Alzheimer's patients Do the unraveling prions ultimately do so much damage to normal brain function that the patient's vital organs simply and systems shut down?
Why do active planet genarally have fewer impacts than bodies like the moon?
What material is resistant to liquid nitrogen?
Why do gametes have different combinations of alleles?
What is the top of the groundwater layer?
The land in Bangladesh is?
What part of the body system produces red blood cells?
What subatomic particle makes the periodic table in the order of elements that it is in?
What does a black outlined triangle on an OS map mean?
Is potassium fat-soluble?
What indusrty needs viscosity?
What is the identity and atomic mass of an atom containing 29 electrons 34 neutrons and 29 protons?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.