0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Why does your skin not wrinkle in salt water?
What is the niche of a leaf?
Chain of many amino acids linked together?
What is renette cell?
What is an example of the ISS contribution to our understanding of the solar system?
What are three protozoan groups and their form of locomotion?
Things that people can have or do on their own?
What is fimbriae made up of?
What are the similarities between a glacier and a geyser?
What tissue has a free surface and cells which are widely separated by extracellular matrix?
What year did measurement would you use to measure hair?
Why does the thickness of the aorta change during a cardiac cycle?
What is the difference between different kinds of crystals?
How many aana equals to 1 dhur?
What does jno stand for?
How much slower should you drive on packed snow?
Is a caress velvet bliss bar of soap antibacterial?
Why is the asthenosphere not capable of storing elastic energy?
How do signal molecules change how a cell will function?
What system of measurement is widely used in the US but is NOT used by the scientific community?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.