0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is the climate to plmouth?
What are the filtering units resposible for maintaining homeostasis?
What can you do in itikaf during mensturation?
Can plants die from negative words?
How are organisms populations communities and ecosystems different?
What are the benefits of using an eco-friendly stove in terms of reducing environmental impact and promoting sustainability?
How do you determine whether a standard propane tank can be refilled?
What does terminal velocity look like on a distance v time graph?
What is enviormental change?
Is converting iron to a steel alloy a physical change?
What is the source of materials for volcanoes that erupt in both ways how do you know?
How do you spell chemistry?
When a small amount of hydrochloric is added to a solution of Na2HPO4the pH of the solution does not change?
What is the term for a natural genetic cross between different breeds?
What are 3 of heliums physical properties?
Is juice healthier with or without the pulp?
What did Gene Simmons do to get a tongue that long how?
What macromolecule does the plant produce to accomplish its big goal?
Can an object have a non zero force and have constant kinetic energy?
Is an ulcer a body system?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.