0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
How do the nose hairs trap the dirt from the oxygen?
What is A branch of the autonomic nervous system that decreases the heartbeat back to normal?
What is GCT?
Who first proposed the idea of Continental Drift and when?
Does earth have three layers?
Does the presence of marine fossils on mountain tops confirm that Noah's Deluge really happened?
How can you separate sand and water?
What are Some physical traits that you get from your parents?
What is the average yield of cassava?
What is a charged species?
Where do the collecting ducts of the renal tubules drain?
What is the sum of 6 feet and 4 yards?
Why mercury considered as ideal thermometric liquid?
Why is the product pyruvate plus unnecessary?
How long is a day on a black hole?
What forms across thr center of a plant cell near the end of telephase?
What determines east and west?
What part of Antonio Lopez de Santa Anna's body was buried?
Why does a kite fall to the ground head first when flying?
What is the system that uses the reflection of underwater sound waves to detect objects?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.