0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is the identity of the element that has an atomic mass of 40.078 amu?
How is chemistry used in agriculture?
How many Body parts with 3 letters that you only have 1 of?
How are elements lighter than iron formed?
What is the noun for acceptable?
What is The number of each type of atom in a chemical formula is given by a?
What is the R-value of a double pane window?
What can go over the water under the water but never touches the water?
Why is not there 3d2 instead of 4s2?
What landforms are there at Hawaiis Volcanoes National Park?
What planet is the hottest because of the thick atmosphere of carbon dioxide?
What would two developing embryos that contained the same genetic code look like?
What does the 15 percent tornado probability from the spc typically mean?
How does earths axis during the winter solstice affect seasons in the northern and Southern Hemisphere?
What are 7 greenhouse gases?
Why are algae important for fish that do not eat algae?
If A scientist places 25 ml of a yellow substance into a 50 ml container the substance quickly fills the entire container is it a solid liquid or gas?
The large comissure that connects the right and left sides of the brain is?
How do anemones look like and a picture of them?
Is cracking eggs a chemial change?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.