0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Why gmsk is used for gsm?
What is the longest food name in the world?
What is the carbon footprint of a fast-food burger?
What is the scale factor of 7 inches to 1 yard?
What size rigid conduit for 200 Amp service entrance using 3 ought wire?
What time was jb born am or pm?
How do the orbits of a moon and a planet differ?
Where did hurricane Gilbert hit?
How many time zones does Mexico have?
How much Is your index finger in inches?
What are the effects of the outside factors on the nervous system?
What is beaching powder?
What is 30 degrees south latitude and 130 degrees east longitude country?
How was the difference between animal and plant cells discovered?
Why are human beings the most wonderful of the world's wonders?
Is millipede a living thing?
What do nuclear fusion and fission have in common?
Is this true about energy in ecosystems energy is transferred between organisims?
What happen to a large portion of the carbon when organic matter decompose?
Where is carbon taken in by plants during photosynthesis stored?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.