0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Does a Venus fly trap need live bugs?
What is the celestial body most like earth that you may inhabit one day?
Do river discharge remain constant?
What is the approximate size for lymphocytes in millimeters?
What is the physiological process that monitors and maintains a balanced and stable internal environment?
How do they find out about the surface on mars?
What is the definition of duplex?
What is the coloration efficiency for nickel oxide films?
How many millimeters is 2 and516 inches?
What of these transports nutrients made in the leaves to all parts of the plant?
What does it mean to narrow a subject?
What is the largest noble gas?
Does deposition occur faster or slower when water currents are slow?
Can you land on Titan?
How to be the best at grow island?
How many hours behind is Spain than England?
Does cell division occur at the same rate in skin cells as in blood cells?
Why is pluto the last planet to the sun?
Is the outside of the sun hotter than the inside of the sun?
Is cycling aerobic?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.