0
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What are four phases mitosis?
How high-performace liquid chromatography works?
Why do I sound weird on recordings something is wrong with my microphone i sound like a very deep robot its not the whole bone skull thingy with vocal cords its my mic?
How did the maps drawn by ptolemy and al-idrisi revolutionize European sea exploration?
Where can you find the cagua volcano?
Which animals would most likely be associated with a kind of behavior referred to as preening?
Why does natural selection does not act directly on genes?
How do you charge your nanovor?
Is fog a form of pecipitation?
What are two discoveries Galilee made by using his telescopes?
What is the reason why diesel is not miscible in water density or polarity?
What does donde nacio mean?
What are subscripts?
When do Plants transfer carbon in the carbon cycle?
When does time goes forward in 2011?
When protonation occurs with carboxylic acid why does the H plus cation go to the carbonyl oxygen?
What is equine microbiology?
Why is laminated glass used for windscreens?
What type of bond if formed when electrons are shared?
What is a river dropping its load called?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.