0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What provide energy for RNA polymerase?
What is the name of system provides the body with stability and the ability to move. It also protects the vital organs?
What is a conical vessel?
Galileo was the first astronomer to describe surface features of the?
What is the caramelizing process called?
What does atomic mass tell us?
Can steel can attract with south pole magnet?
At what distance from the Sun would a planets orbital period be 3 million years?
Does Transgenic organisms occur often in nature?
What food products containing lactic acid bacteria?
What time is it in new Germany Mn?
What is the tale and legends of mt st Helen?
How is a way that geological processes affect nutrient cycling?
Males can be born with one or both what?
What are a seahorses acquired traits?
What do tectonic plates do at a transform plate boundary?
What is the time difference between the Dominican Republic and the Eastern Time zone?
The shifting of electrons in an atom .?
What is a hot lava cooling and hardening?
Can you buy Mercury?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.