0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
How does soil erosion affect people?
How does reproductive success affect survival?
What is the distants between the equator?
Why will water diffuse into a bacterial cell placed in fresh water?
What proteins on surface of cells have carbohydrates attached to protein?
How long after the earthquake in Japan did the tsunami hit in 2011?
Which is the largest planet in your solar system and shares its name with the king of the roman gods?
How do you separate benzoic acid and biphenyl and a basic organic solid?
When a gas is cooled and becomes a liquid?
Are fox gloves poisons?
Pollutants contaminate the water supply. is this true or false?
To what extent has technical progress altered the shape of the production function?
what are rocky planets and why are these called rocky planets?
What is sesory receptors in the detect light?
How many kilometers are in 6000 miles?
Is brain a most radiosensitive tissue?
How do you cut out a epidermal cyst?
What would a vacuole be in a factory?
What frequencies of visible light are transmitted through a piece of glass if the glass appears clear?
How can culturing a n organism on several different types of media can help identify an organism in a relatively shor period of time?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.