0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is offered by Weather Guard?
Why is atom of sulfur smaller than an atom of silicon despite sulfur having more mass?
Do the clocks go back in Holland?
Does sii4 have any polar bonds?
Why were Europeans interested in Kenya?
Where can you get additional keys for your Saturn vue 2002?
What ocean contains 46 of the earths water?
Where do you find uranium in US?
Who invented the fastball?
What halogen salt is the mot soluble at all temperatures?
Does the point where the prime meridian and equator meet have a special name?
How many inches are in 340 mm?
What is intrusive crystallisation?
Should water content or LOD be subtracted from potency?
What substance makes starch?
What is first fill?
What is Beaver Country Times?
What cause green hause gasses?
What is the point of origin for Halley comet?
How did Mount Vesuvius effect the land?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.