0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Where are white cliffs located?
How does Eumaeus react to this appearance?
Which are the ten most famous ocean liners of the 20th century?
What is A sentence for producers in scientific form?
Which Gang is the Strongest in WeeWorld?
Can physical method be used to separate molecules in crude oil?
What year did Voyager 1 arrive to Saturn?
Which body system do the kideny belong to?
What is the spinnning rotation of a planet from east to west called?
What meridian begins on the medial eyebrow and runs over the top of the head down the back and down the leg?
How does guava disperses its seeds?
Could cellular respiration happen without photosynthesis Explain?
What separate the crust from the mantle?
The process by which nuclear material is divided equally between two new cells?
Is kilauea a MEDC or LEDC country?
What bacterial STD is sometimes associated with mild discharge in men and women?
Which will not form water and carbon dioxide when it burns?
10 examples of acid and base compound?
What are 2 ways glaciers erode the land?
When uranium -238 decays to form thorium-234 the uranium nucleus emitts?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.