0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Was it Atlantic time zone since the Titanic was in the Atlantic?
Intrusive igneous rock is cooled and solidified above ground?
Do plants with more leaves grow faster than plants with fewer leaves?
What is an electric potential that increases the likelihood that the postsynaptic neuron will fire is called an?
How do people survive rapid ecosystem changes?
What is represented differently in males and females of the same species?
What are the subnits?
How mant stars are in our solar system?
Why does your hand feel cold when a piece of ice is placed in your hand?
How many molecules of oxygen is need to make water?
When one of your classmates states a hypothesis that all organisms must have organ systems is your classmate's hypothesis valid?
What is the difference between cycle and hertz?
What growth problems does Turner syndrome cause?
Where did Isaac Newton grow up?
What are some organic compounds that begin with the letter E?
How much 100 militer in liter?
What is a underground chamber that opens to the surface?
How many decimeters in 2 kilometers?
A change in the shape of rock caused by a force placed on it?
What time would it be in London if its 11 am in New York?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.