0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What effect does hemolysis have on CO2 values?
How many miles by boat from North Carolina to Bermuda?
Is the water table below the layer of impermeable rock?
What companies offer no credit check cell phones?
Why is rececse important?
Why do trees need to be firmly anchored in the ground by their roots?
Is the fossil of a fern leaf more likely to be found as a cast or a mold why?
Are propane gas stoves safe to use in homes?
How is a shade plant different from a sun plant?
In which phase of matter do fusion reactions occur?
Why is important to identify microbes in the disease process?
When speed of the light will be minimum?
Why does the story spontaneous generation illustrate the limitations of science?
Are viruses organic?
Was johns Hopkins a white man or black man?
Who discovered hydroenergy?
What does nitrogen have to do with the ability to do things?
Why are the algae leaving?
You gave the plant a lot of water but in the end it still wilted?
Does a trout have a segmented body?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.