0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
How many feet equals two meters?
How do you get the plastic cover off headlights to clean the inside i have a 92 topaz?
The Sinai Peninsula is the home of modern Turkey True or False?
What is planet Venus's air made of?
What is the tube like structure of the pistil?
What did Johannes Friedrich Miescher discover?
What are the basic ingredients of crust making?
What substance would you add to to form a buffer solution CH3COONa?
How is atmospheric pressure affected by Warm air mass pushes into cold air?
Why does your blood need to be pumping through your body?
What is a type of rock basalt?
Are light rays sent to the brain through the optic nerve?
What is the name of Storage chamber within the cell?
What Code specifies the amino acids and start and stop signals with their Codons?
What is the mid-Atlantic ridge made up of?
Comtemplate why the distance from the sun is an important factor for a planet to support life?
What kind of energy is produced by battery?
Why is mercury a liquid at room temperature and pressure?
What are Some characteristic of intensifiers?
What is the name of the old fort 70 miles west of key west Florida?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.