0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
In a famous experiment Rutherford bombarded a very thin gold (Au) foil with positively charged alpha particles. They found that most of the alpha particles passed right through the Au foil. However a?
Was Browns Plains affected by the floods in Brisbane 1974?
Which spheres in the diagram are the Na plus ions and which spheres are the cl ions?
A particle in the nucleus of an atom it has a positive electrical charge and the times of the election?
Can magnesium carbonate be made as a precipitate by reacting together magnesium sulfate and calcium carbonate?
What part do wildfires play in the life cycle of a forest?
A wet-mount slide preparation of a specimen is stained in order to?
How many electrical companies are there in US?
What is a northerly wind?
How can you become a professional scientist?
What is the layer in Earth's mantle between the lithosphere and upper mantle?
What happens to the attractive forces between the particles in a gas?
Where are Njs deciduous forest regions?
What is a Cpl's inferior rank?
What are the importances of wind?
What fault Rock layers are placed under compressional stress?
What was Amerigo Vespucci set out to do?
What is the by product mixture of H202 and NaCl?
What is the history of Mt Laki?
What is the cleavage of igneous rocks?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.