0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What are vertical and horizantal columns on the periodic table called?
Cells that provide for sense of taste?
Are snails evil?
Does the air contain non-metal elements?
How cold does mercury get in winter?
How can climate change be considered as social?
What are 3 types of nerve agents?
How are selective breeding techniques of hybridization and inbreeding opposite?
What do you call a person who does interlocking and works with patio stones?
How much did the 1997 El Nino increase the water temperature in the pacific ocean?
Why post-translational modification of protein does not occur in prokaryotes?
Molecule that provides instructions for making proteins?
What color do you associate with sapphire and azure?
What is the difference between parent nucleus and daughter nucleus?
Radioactive dating of fossils depends on the decay of what?
Which convergent plate boundry does not include a subduction zone and why?
The careful observation of behavior in real-life settings is called operational defining?
What are the most common chat used in excl?
The proximal end of the forearm refers to?
Why only sugar and salt samples are used in Combined test piece?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.