0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
How many is 12oz equals in lb?
What is a consists of a star and all of the bodies in orbit around it?
Are there harricanes on Mars?
What theory promotes the idea that only the strongest living organisms that can adapt to its surroundings survive?
How many pairs of gills does a trout have?
What are the four primary functions of hardrive?
Why do satellites stop being visible?
What do tiny openings do?
9 hours equal how many seconds?
How many joules of work are done on an object when a force of 10 N pushes it a distance of 5 m?
Does amylase work inside or outside the cells?
Can you use a 1000VA transformer to power 1500 watt oven?
How many km ar from sun to Jupiter?
Is the map of Guyana a political or physical map?
What is Menactra vaccine?
Is a slug a herbivore?
What does it mean if mineral grains in a metamorphic rock are arranged in bands?
Is tonic water high in magnesium?
What does the company O2 treats provide?
Is wet sand heterogenous or homogenous?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.