0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Is a bean burrito a heterogeneous mixture?
What are the imaginary lines on a map that measure distance from the equator?
Where are operations carried out carried in a operating?
Who is the protagonist of the legend of mayon volcano?
What is the difference between stem ginger and root ginger?
How does temperature affect natural vegetation?
What is a 1 meter in centimeter?
Why is it easier for group 14 elements in the periodic table to become stable instead of transferring electrons?
How much does a black hole weigh?
How is ventilation controlled in response to changing demands on the body?
Is a way of life of people living in steppe climate zone in Africa?
Chemical composition of pandan leaves that affects cackroaches?
Would humidity cause a solid vinyl plank to peak?
Is Cherenkov radiation always associated with radioactivity?
Where is there a zoo in California?
Predict how an ecosystem would respond if either its producers or its detrivores and decomposers were removed Be sure to explain your reasoning?
What is the functional group for C6H14?
Are buds found in the leaf axils of the shoot?
Make a list of 150 chemical compound with their formulas?
What is a large arm of a body of water partly surrounded by land?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.