0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
A change in DNA that can lead to the development of cancer?
Is there waether on Saturn?
In multicellular organisms different type of cells can perform different types of tasks this is best described as?
What is a substance table salt seawater or sand Explain how you know?
isotherms are imaginary lines drawn on a map which connect places of equal?
What is The Atomsphere Composition Of EArth?
What are cyclones called in Australia?
What does potassium-40 break down into over time?
How do you change dryer plugs?
Why do reflecting telescopes use concave mirrors?
What are the disadvantages of complete combustion?
Convert 70 x 100 cm to inches?
What is the proper Lewis structure for Cl3PO?
If you hang a magnet on a piece of cotton which way would it point?
Are forest fires easy to solve?
How is hydrogen changed into helium in nuclear fission?
Can animal cells make their own cells?
How thick a concrete wall would be needed to give the same insulating value as 3 and a half inches of fiberglass?
How much of a 100-g sample of thorium-234 will be unchanged after 48.2 days?
What is the cell theory of a human body?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.