0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Which of these is a zone in which one plate is pushed down into the mantle underneath another plate?
What has more ionization energy available 12.6 volts or 6.3 volts?
What is the two brightest body in the solar system?
How many significant figures in 65001g?
How was zinc first used?
Which state borders four other states in Australia?
How much does a steel tank weigh in pounds?
How many ounces in 1 lb?
What is the largest country in the world in terms of surface?
What is the wormhole formula?
Why might a car manufacturer change the shape of side mirros on a particular model?
Was Wittgenstein for or against the creation of an ideal language?
What forces shape contemporary Filipino values?
Were there mudflows in the eruption of Mount St Helens?
The total number of grams of CO2 that are produced when 4 grams of C are added to 10.67 grams of O2?
Is cooling air cause by particles moving together?
What are glaciers and how do they change the geography of a region?
What do people use snow leopard fur for?
Is malleus is attached to the typanic membrane?
How have biotic and abiotic factors affect the galapagos islands?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.