0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What are four main biomolecules of life?
Why is the sun so important to our solar system?
Why is domestication important?
How large is mayon?
Why is it called climate change and not global warming.?
How do we know that stoneworts are close relatives of plants?
Can anywhere in the world be more than twelve hours in front of anywhere?
Is the presence of starch a fairly good indication of cholorophyllous tissue in a leaf?
A place where a major earthquake has happened in the past but not recently is called a seismic?
If an organism has alleles Bb it is?
What is reactive gas?
What are career stages?
What is the distance of luzon from mindanao in the Philippines?
Why is the mitochondrion good at its job?
What is one probable way in which the M. leprae bacilli is spread?
How many lakes does Idaho have?
What is bacterial mutation?
Which business in a conglomerate earns the most profits?
What area of the eye is insensitive to light?
Are your ears lateral from your nose?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.