0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Is wooden an adjectives?
What is a solution with lower concentration called?
What is the destruction of the ozone doing to the health of people?
In the big bang model descrbes a universe that will stop expanding and begin to contract?
You want to see if mold grows faster on bread in the shade than on bread in the sun What if your experimental variable is?
How does IMD predict weather?
How are neurons able to generate tiny electrical currents?
How do you convert the following direct statement scale 1 CM equals 102.922488 KM to a RF scale?
What are egg layers called?
How much time should you wait to take your iron tablet since taking the calcium and magnesium ones?
Why does a mirror get moist if a room's temperature is high?
What was john harvey's discorvery during the scientific revolution?
What is a contributor to the emission of additional methane into the atmosphere?
What bacteria break down dead organisms?
Can you eat a sprouting onion?
What is the opposite of predict?
Who used astronomical observation and mathematical calculation to disprove the Hellenistic belief that the Earth was the center of the universe?
Location of Acetyl CoA in a cell?
What causes volcanism?
What carries spores?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.