0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
How many kilograms is 1 ton lime?
What is the outer covering like for a echinoderm?
What atoms with either a positive or negative charge called?
How does strength affect sports perfomance?
What would you expect to influence an Rf value?
What is usually the farthest from the sun and is always dark?
Which types of disposable cups maintain the temperature of a liquid longer?
Why does the Arabian peninsula have small amounts of farming?
Can credit cards be recycled?
What are the strong forces of attraction called between the positive and negative regions of molecules called?
What is fiord formed by?
What is a black non metal with three allotopes diamond. graphite and charcoal?
What is the minimum number of four-way switches required to control a ceiling-mounted fan from seven locations?
What is an example of one organism benefiting from another organism?
What causes third spacing?
How does health affect chemistry?
What is the amount of genes in an animal cell?
How do radio waves and x rays compare in terms of wavelength and energy?
What happens if you broke your growth plate?
If you separate the pigments found in a typical plant cell's chloroplasts what will you find?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.