0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What is the name of the enzyme in hair?
What is produced by the end of the?
How long From Hawaii to Vancouver bc?
What Mexican state is located at 25 north latitude 100 east longitude?
Is the inner core the hottest place on earth?
Can there be pre seminal fluid discharge without stimulation?
Which is better pcb or pcm?
What two factors about wind are meteorologists interested in?
What structures do the amoeba paramecium and euglena all have in common?
Is berocca a antacid?
How many non drinkers?
Why colloid is electrically charged?
What plants live in the semi arid desert?
What are the current issues and problems in Philippine education management process?
Which lake does the equator pass through Lake Victoria Lake Malawi or Lake Chad?
El nino causes a vast sheet of water to move across the pacific ocean toward the coast of?
Why do different parts of the body twitch when when trying to sleep?
The study of organisms based on their similar body structures is referred to as what?
Can Anikan use force lightning?
What time will santa get to lamar Colorado?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.