0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
What would you see if the moon disappeared during a full moon phase?
How many ATP nadh and fadh are produce in each step of cellular respiration?
Why dies metal casting make use if the different characteristics of liquids and solids?
What texture of obsidian?
How do we know that the planets rotate?
Where does the Replication of DNA molecule happens?
What bond is usually stronger?
How far is it from Virginia to Spain?
What does historical parallels mean?
What is the basic difference between electron affinity and electro negativity?
What are the odds of successfully navigating an asteroid field?
How many grains in 1 ounce of silver?
Is noble gases metals that are more reactive than the transition elements but less reactive than the alkali metals?
From what family is rafflesia?
Is a puddle drying up in the sun a chemical or physical change?
What means binding and fixation?
How many neutrons does zinc have show work?
Which of the following groups requires more irregular scheduling than the other three groups?
Why are there holes in someigneous rocks?
Can a position time graph have negative slope?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.