0
It is 'hexanoic acid' or 'caproic acid'.
What else can I help you with?
Continue Learning about Natural Sciences
Related Questions
Molecular formulae for 2-hydroxybenzoic acid?
what is the molecular formulae for 2-hydroxybenzoic acid
What is the name of a compound with the structure CH3CH2CH2CH2CH2CO2CH2CH2CH3?
This is an impossible compound formula: at the 5th C there can be either ONE oxygen atom (-CO-) or 2 hydrogen atoms (-CH2-, not -CO2-);In those corrected cases the names would be eithern-nonanon-4: CH3CH2CH2CH2CH2C(O)CH2CH2CH3or n-nonaan : CH3CH2CH2CH2CH2C(H2)CH2CH2CH3
Trending Questions
Can brown hair brown eye boy and blond hair green eyed girl have a blond hair blue eye baby?
The process of connecting separate networks together is called?
How are metallic ores useful?
Is euglena like an algae?
What atomic particles are most important in determining chemical reactions and why?
When did Amerigo Tot die?
What is the proton of Li?
What is the protein RDA for person weighing 176 pounds?
How do you make cannabis resin?
How have organisms adapted to their changing environment from the precambrian time to the Cenozoic era?
What is the layer just below Earth's surface called?
When the magnetic fields of two or more magnets overlap the result is a combined field. True False?
If a tectonic plate moves 4 cm per year how many kilometers would it move in 1 million years?
What does Scavenger mean biology?
How many centimeters are in 1.2 meters?
If an animal with 2 dominant genes for a trait has offspring with an animal with 2 recessive genes for same trait their offspring can only have what?
Is there any particles other than Proton and Neutron and electron?
Which volcanoes are formed from both flowing lava and falling cinder and tephra?
What happens when you mix acetone and viniger?
How many does it take for styrofoam to destroy?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.