0
The condensed formula for 1-butyl-4-methylcyclodecane can be represented as C₁₄H₂₄. In this compound, a butyl group (C₄H₉) is attached to the first carbon of the cyclodecane ring, and a methyl group (C₁H₃) is attached to the fourth carbon of the ring. The overall structure indicates a cyclodecane framework with these substituents.
What else can I help you with?
What is the correct condensed structural formula for 1-pentene?
The condensed structural formula for 1-pentene is CH3CH2CH=CHCH3.
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the condensed formula for c2h4cl2?
The condensed formula for C2H4Cl2 is CH2Cl-CH2Cl.
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
What is the condensed structural formula for N Methylaniline?
The condensed structural formula for N-methylaniline is CH3C6H4NH2.
What is the correct condensed structural formula for 1-pentene?
The condensed structural formula for 1-pentene is CH3CH2CH=CHCH3.
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the condensed formula for benzene?
The condensed formula for benzene is C6H6.
What is the condensed formula for c2h4cl2?
The condensed formula for C2H4Cl2 is CH2Cl-CH2Cl.
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
What is the condensed formula for ethanol?
The chemical formula of ethanol is C2H5OH.
What is the condensed structural formula for N Methylaniline?
The condensed structural formula for N-methylaniline is CH3C6H4NH2.
What is the condensed stuctural formula for ethanol?
The condensed structural formula for ethanol is CH3CH2OH.
What is the condensed structural formula for 22 dimethylbutane?
The condensed structural formula for 2,2-dimethylbutane is CH3C(CH3)2CH2CH3.
What is the condensed structural formula of pentyl acetate?
The condensed structural formula of pentyl acetate is CH3COO(CH2)4CH3.
What is the condensed structural formula for 4-decene?
The condensed structural formula for 4-decene is CH3(CH2)8CH=CH2.
What is the condensed structural formula for the compound, and can you indicate it in a single question?
What is the condensed structural formula for the compound, and can you indicate it in a single question?
