answersLogoWhite

0

Atomic number remains same for another isotope but only mass number changes. So it will be 1

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What does a single straight line (-CH3) extending from an atomic symbol represent?

Single covalent bond.


What is the atomic symbol of ethane?

Ethane is not an atom, but a molecule whose condensed formula is H3C - CH3


How do you find oxidation number of carbon in CH3-CH2-OH?

The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.


What is the reaction for the preparation of ethylene dibromide from ethene?

When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl


This element has an atomic number that is double the atomic number of silicon?

this elemnt has an atomic number that is double the atomic number of silicon?


What 2 4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


What is the number of protons in the neucleus called?

the answer is that it is called a atomic number.


What’s 2×4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


What is the correct structure of 3-ethyl-3-methylhexane?

The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3


This element has the atomic number that is double the atomic number of silicon?

The element with an atomic number that is double the atomic number of silicon is germanium, with an atomic number of 32. Silicon has an atomic number of 14.


Element has an atomic number that is double the atomic number of silicon?

The element with an atomic number that is double the atomic number of silicon is germanium, with atomic number 32. Silicon has an atomic number of 14.


Atomic number in the atomic nucleus?

The atomic number is equal to the number of the protons in the atomic nucleus.