0
What else can I help you with?
What is the reaction for the preparation of ethylene dibromide from ethene?
When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl
What is the atomic number of F plus the atomic number of Na?
The atomic number of fluorine is 9.The atomic number of sodium is 11.
What is an example of Atomic Number?
Atomic number= number of protons. Hydrogen atomic number=1
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Can you make two structural isomers from a saturated alkane C4H10?
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
What is the atomic symbol of ethane?
Ethane is not an atom, but a molecule whose condensed formula is H3C - CH3
What does a single straight line (-CH3) extending from an atomic symbol represent?
Single covalent bond.
How do you find oxidation number of carbon in CH3-CH2-OH?
The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.
What is the reaction for the preparation of ethylene dibromide from ethene?
When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl
This element has an atomic number that is double the atomic number of silicon?
this elemnt has an atomic number that is double the atomic number of silicon?
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is the number of protons in the neucleus called?
the answer is that it is called a atomic number.
This element has the atomic number that is double the atomic number of silicon?
The element with an atomic number that is double the atomic number of silicon is germanium, with an atomic number of 32. Silicon has an atomic number of 14.
Element has an atomic number that is double the atomic number of silicon?
The element with an atomic number that is double the atomic number of silicon is germanium, with atomic number 32. Silicon has an atomic number of 14.
What’s 2×4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Atomic number in the atomic nucleus?
The atomic number is equal to the number of the protons in the atomic nucleus.
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
