Atomic number remains same for another isotope but only mass number changes. So it will be 1
When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl
The atomic number of fluorine is 9.The atomic number of sodium is 11.
Atomic number= number of protons. Hydrogen atomic number=1
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
CH3-CH2-CH3 is a gas Propane.
Ethane is not an atom, but a molecule whose condensed formula is H3C - CH3
Single covalent bond.
The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.
When ethyl chloride is reduced with atomic hydrogen ethane and HCl are formed, Zn + 2HCl -------> ZnCl2 + 2[H] CH3-CH2-Cl + 2[H] -----> CH3-CH3 + HCl
this elemnt has an atomic number that is double the atomic number of silicon?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
the answer is that it is called a atomic number.
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
The element with an atomic number that is double the atomic number of silicon is germanium, with an atomic number of 32. Silicon has an atomic number of 14.
The element with an atomic number that is double the atomic number of silicon is germanium, with atomic number 32. Silicon has an atomic number of 14.
The atomic number is equal to the number of the protons in the atomic nucleus.