answersLogoWhite

0

4 atoms are present in one molecule of CH3

So it is Polyatomic

User Avatar

Anonymous

5y ago

What else can I help you with?

Related Questions

What is the atomicity of ozone?

the atomicity of ozone is 3 hehehehe./////////////......................


What is atomicity of neon and phosphorus?

The atomicity of neon is 1, meaning it exists as individual atoms. Phosphorus can exist in several allotropes with different atomicities: white phosphorus has an atomicity of 4, red phosphorus has an atomicity of 1, and black phosphorus has an atomicity of 1.


What is the atomicity of oxygen in ozone?

The atomicity of oxygen in ozone is 3. This means that each molecule of ozone contains three oxygen atoms.


Explain how you can determine the atomicity of a gas?

To find the atomicity of an ideal gas you can use γ = Cp/Cv.


What is the atomicity of hydrogen?

Hydrogen has an atomicity of 1, meaning that its molecules consist of single hydrogen atoms.


What is atomicity of molecules?

Atomicity refers to the number of atoms in a single molecule of a substance. It can describe both simple molecules, like diatomic oxygen (O₂) which has an atomicity of 2, and complex molecules like glucose (C₆H₁₂O₆) which has an atomicity of 24 due to its multiple atoms of carbon, hydrogen, and oxygen. In essence, atomicity helps categorize molecules based on their composition and structure.


What 2 4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane


How do you find atomicity?

23


What is the atomicity of chloride?

35.4528


What is atom city?

atomicity in chemstry atomicity is defined as the total number of atoms present in one molecule of substance


What is the atomicity of rubidium?

Atomicity ? Well one definition is the same as valency which for rubidium is 1.


What’s 2×4?

CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane