4 atoms are present in one molecule of CH3
So it is Polyatomic
Atomicity refers to the number of atoms in a single molecule of a substance. It can describe both simple molecules, like diatomic oxygen (O₂) which has an atomicity of 2, and complex molecules like glucose (C₆H₁₂O₆) which has an atomicity of 24 due to its multiple atoms of carbon, hydrogen, and oxygen. In essence, atomicity helps categorize molecules based on their composition and structure.
For chemists the meaning of atomicity is the number of atoms in a molecule. In the past, rarely, the word atomicity was used as an equivalent for valence (if you think to valence the answer is very long for WA for all the elements).
The atomicity of an element refers to the number of atoms present in a single molecule of that element. For example, oxygen has an atomicity of 2 because its molecule contains 2 oxygen atoms (O2), while helium has an atomicity of 1 since it exists as single atoms (He).
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
CH3-CH2-CH3 is a gas Propane.
the atomicity of ozone is 3 hehehehe./////////////......................
The atomicity of neon is 1, meaning it exists as individual atoms. Phosphorus can exist in several allotropes with different atomicities: white phosphorus has an atomicity of 4, red phosphorus has an atomicity of 1, and black phosphorus has an atomicity of 1.
The atomicity of oxygen in ozone is 3. This means that each molecule of ozone contains three oxygen atoms.
To find the atomicity of an ideal gas you can use γ = Cp/Cv.
Hydrogen has an atomicity of 1, meaning that its molecules consist of single hydrogen atoms.
Atomicity refers to the number of atoms in a single molecule of a substance. It can describe both simple molecules, like diatomic oxygen (O₂) which has an atomicity of 2, and complex molecules like glucose (C₆H₁₂O₆) which has an atomicity of 24 due to its multiple atoms of carbon, hydrogen, and oxygen. In essence, atomicity helps categorize molecules based on their composition and structure.
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Atomicity ? Well one definition is the same as valency which for rubidium is 1.
atomicity in chemstry atomicity is defined as the total number of atoms present in one molecule of substance
35.4528
23
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane