answersLogoWhite

0

CH3 is not a chemical equation, it is a chemical formula. CH3 is a methyl but, it can not be on its own.

User Avatar

Wiki User

11y ago

What else can I help you with?

Related Questions

What is the chemical equation for isobutane?

The chemical equation for isobutane is C4H10.


What is the balance equation for the addition of sodium bisulfate to acetone?

CH3 - C - CH3 + NaHSO3 ------> CH3 - C -OH


What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?

The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O


What is the equation of 2 iodohexane with sodium methoixde?

CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI


Is ch3 electron donating or withdrawing in a chemical reaction?

In a chemical reaction, CH3 is electron donating.


What is CH3?

Hi, CH3 is chemical formula of methyl group.


Chemical equation of ethanol?

This reaction depends upon ratio of both the reactants, ethanol with a largequantity of concentrated sulphuric acid on heating produces ethene. CH3-CH2-OH = CH2=CH2 + H2O But if ethanol is in excess then Diethyl ether is formed. 2CH3-CH2-OH = CH3-CH2-O-CH2-CH3 + H2O


What is the reaction equation of 1-butene and water?

Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3


What is the balanced chemical equation for the burning of ethanol?

C2H5OH +3O2 gives 2CO2 +3H2O ...it burns with ablue flame in air


How do you write a balanced equation for acetone?

To write a balanced equation for acetone (C3H6O), you would typically need to react it with another chemical compound. For example, if you were to react acetone with oxygen (O2), the balanced equation would be: 2 C3H6O + 9 O2 → 6 CO2 + 6 H2O


What is the chemical formula for butyric acid?

C4H8O2 , CH3-CH2-CH2-COOH Butyric acid and CH3-CH(CH3)-COOH isobutyric acid.


What is the chemical name for CH3 CH3?

CH3 is 1 atom carbon-dioxide(carbon for short) to 3 atoms of helium. But it's not methane - methane is CH4.