0
What else can I help you with?
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the chemical formula for methylbutane?
The chemical formula of methylbutane is C4H9-CH3.
What is the chemical formula of dimethyl hydrazine?
(CH3)2NNH2
What is dimethyfuran?
The chemical formula of dimethylfuran is (CH3)2C4H2O.
What is the chemical formula of rubbing alcohol ispropyl?
The chemical formula of isopropyl rubbing alcohol is C3H8O, also known as isopropanol or isopropyl alcohol.
What is the chemical equation for isobutane?
C4H19 Structurally it can be (CH3)2-CH-CH3
What is the balance equation for the addition of sodium bisulfate to acetone?
CH3 - C - CH3 + NaHSO3 ------> CH3 - C -OH
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
Is ch3 electron donating or withdrawing in a chemical reaction?
In a chemical reaction, CH3 is electron donating.
What is CH3?
Hi, CH3 is chemical formula of methyl group.
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
Chemical equation of ethanol?
This reaction depends upon ratio of both the reactants, ethanol with a largequantity of concentrated sulphuric acid on heating produces ethene. CH3-CH2-OH = CH2=CH2 + H2O But if ethanol is in excess then Diethyl ether is formed. 2CH3-CH2-OH = CH3-CH2-O-CH2-CH3 + H2O
What is the balanced chemical equation for the burning of ethanol?
C2H5OH +3O2 gives 2CO2 +3H2O ...it burns with ablue flame in air
How do you write a balanced equation for acetone?
To write a balanced equation for acetone (C3H6O), you would typically need to react it with another chemical compound. For example, if you were to react acetone with oxygen (O2), the balanced equation would be: 2 C3H6O + 9 O2 → 6 CO2 + 6 H2O
What is the chemical formula for butyric acid?
C4H8O2 , CH3-CH2-CH2-COOH Butyric acid and CH3-CH(CH3)-COOH isobutyric acid.
What is the chemical name for CH3 CH3?
CH3 is 1 atom carbon-dioxide(carbon for short) to 3 atoms of helium. But it's not methane - methane is CH4.
