answersLogoWhite

0

Do you mean cyclopentadiene? Do you mean formula? If so, cyclopentadiene is a ring of 5 carbon atoms with double bonds at positions 1 and 2 or 1 and 3. All bonds outside of the carbon-carbon bonds in the ring are to the 6 chlorines. It contains no hydrogen.

User Avatar

Wiki User

16y ago

What else can I help you with?

Continue Learning about Natural Sciences

What is the chemical formula for NyQuil?

The chemical formula for NyQuil varies based on the specific formulation, but it typically contains acetaminophen, dextromethorphan, doxylamine succinate, and sometimes pseudoephedrine.


What is the chemical formula for body wash?

Body wash typically contains a combination of surfactants, fragrances, preservatives, and other additives that can vary depending on the brand and the specific formulation. There is no single chemical formula for body wash.


Is sunscreen a acid or a base?

Sunscreen is neither an acid nor a base; it is a formulation that can contain a mix of ingredients, including chemical filters, physical blockers, moisturizers, and emulsifiers. The pH of sunscreen can vary depending on its specific formulation, but most are designed to be skin-friendly and typically have a neutral to slightly acidic pH. This helps to ensure compatibility with the skin and avoid irritation.


What is the chemical composition of Chloroamphenicol suspforulation?

Chloramphenicol is a complicated molecule with the SMILES formula c1cc(ccc1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-]. If you don't read SMILES, that's probably not especially helpful."suspforulation" isn't a real word; I suspect it refers to the formulation and just means that the chloramphenicol is in a water suspension.


How Antoine Lavoisier findings and studies relates to law of conservation of mass?

Antoine Lavoisier's findings and studies on chemical reactions led to the formulation of the law of conservation of mass. He demonstrated that in a chemical reaction, the total mass of the reactants is equal to the total mass of the products, showing that matter is neither created nor destroyed in a chemical reaction. Lavoisier's work laid the foundation for modern chemistry and our understanding of the conservation of mass.

Related Questions

What is the chemical name for dial body wash?

There is no chemical name for it. That is a propietary commercial soap mixture formulation.


What is the chemical formulation of perflourinated compounds?

Perflourinated compounds are organic fluorine compounds with bonds C-F and C-C.


What is the difference between Hcl or ER?

HCL stands for hydrochloric acid, which is the chemical compound found in the stomach that aids in digestion. ER stands for extended-release, which refers to a medication formulation designed to release the drug over an extended period of time in the body. They are different in terms of their chemical composition and purpose.


What is the importance of the acid base nature of a drug in drug formulation?

Certain chemical bonds are weakened due to acidic/alkolinic states.


Explain why problem formulation must follow goal formulation?

In Problem formulation method ,goal is a parameter to provide which (goal) is formulated in goal formulation method.that's why problem formulation must follow goal formulation. suacsecu


How much chemical fertilizer can you use on plants?

depends entirely on the type and formulation of the chemical fertiliser. normally fertilisers with a high nitrogen proportion (e.g. Urea, Ammonium Nitrate etc.) need to be used very carefully to prevent "chemical burning" of the plant


What chemical name will show up in a drug test from taking Percocet?

Percocet is a brand-name drug formulation for acetaminophen with oxycodone. It would show up as the chemical oxycodone.


What is the chemical density of testosterone?

The chemical density of testosterone is approximately 1.06 g/cm³. This value can vary slightly depending on the specific formulation and purity of the testosterone sample. Testosterone is a steroid hormone, and its density reflects its molecular structure and composition.


Formulation of PVA in paint?

I need the formulation for Industrial PVA paint


What is formulation nitrile rubber?

we need the best nitril rubber formulation


What does geological formulation tell us about the Hydrocarbon behavior?

The formation of Hydorcarbons is related to the geological formulation. Based on the geological formulation, we can determine the behaviours of the Hydrocarbons.


Why problem formulation must follow goal formulation in artificial intelligence?

In goal formulation, we decide which aspects of the world we are interested in, and which can be ignored or abstracted away. Then in problem formulation we decide how to manipulate the important aspects (and ignore the others). If we did problem formulation first we would not know what to include and what to leave out. That said, it can happen that there is a cycle of iterations between goal formulation, problem formulation, and problem solving until one arrives at a sufficiently useful and efficient solution. @ oneous.com