0
The condensed formula for 1,2-dibromobenzene, also known as ortho-dibromobenzene, is C6H4Br2. In this compound, two bromine (Br) atoms are attached to adjacent carbon atoms on a benzene ring, resulting in a total of six carbon atoms, four hydrogen atoms, and two bromine atoms.
What else can I help you with?
What is the correct condensed structural formula for 1-pentene?
The condensed structural formula for 1-pentene is CH3CH2CH=CHCH3.
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
What is the condensed formula for c2h4cl2?
The condensed formula for C2H4Cl2 is CH2Cl-CH2Cl.
What is the condensed structural formula for N Methylaniline?
The condensed structural formula for N-methylaniline is CH3C6H4NH2.
What is the correct condensed structural formula for 1-pentene?
The condensed structural formula for 1-pentene is CH3CH2CH=CHCH3.
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
What is the condensed formula for benzene?
The condensed formula for benzene is C6H6.
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
What is the condensed formula for c2h4cl2?
The condensed formula for C2H4Cl2 is CH2Cl-CH2Cl.
What is the condensed formula for ethanol?
The chemical formula of ethanol is C2H5OH.
What is the condensed structural formula for N Methylaniline?
The condensed structural formula for N-methylaniline is CH3C6H4NH2.
What is the condensed stuctural formula for ethanol?
The condensed structural formula for ethanol is CH3CH2OH.
What is the condensed structural formula for 22 dimethylbutane?
The condensed structural formula for 2,2-dimethylbutane is CH3C(CH3)2CH2CH3.
What is the condensed molecular formula of methoxyethane?
The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3
What is the condensed structural formula of pentyl acetate?
The condensed structural formula of pentyl acetate is CH3COO(CH2)4CH3.
What is the condensed structural formula for 4-decene?
The condensed structural formula for 4-decene is CH3(CH2)8CH=CH2.
