0
What else can I help you with?
How many hydrogens in eicosane?
Eicosane is a straight-chain alkane with the chemical formula C20H42. This means it contains 20 carbon atoms and 42 hydrogen atoms. Therefore, eicosane has 42 hydrogen atoms in total.
How many protons are in C6H8O6?
The molecular formula C6H8O6 contain 20 atoms.
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
Are all the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
How many Hydrogen atoms are in an Alkane with 7 Carbon atoms?
Alkanes have the general formula of CnH2n+2 so for 12 carbons, that would be 2x12 + 2 = 26 hydrogen atoms.
How many hydrogens in eicosane?
Eicosane is a straight-chain alkane with the chemical formula C20H42. This means it contains 20 carbon atoms and 42 hydrogen atoms. Therefore, eicosane has 42 hydrogen atoms in total.
How many hydrogens are present on an alkane with 20 carbons?
An alkane with 20 carbons will have 42 hydrogens. This can be calculated using the formula 2n+2, where n is the number of carbons (C) in the alkane. So for an alkane with 20 carbons, the number of hydrogens would be 2(20) + 2 = 42.
How many protons are in C6H8O6?
The molecular formula C6H8O6 contain 20 atoms.
What is the molecular formula for turpentine?
Turpentine is a mixture of hydrocarbons just like kerosene oil it contains hydrocarbons having carbon atoms 11 to 20 or more
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
What is phenolphthalein molecular weight?
It has the molecular formula C20 H14 O4. Thus its Mr is (12*20+1*14+16*4) or 318.
How many micromoles is 20 micrograms?
To convert micrograms to micromoles, you need to know the molecular weight of the substance. The formula to convert micrograms to micromoles is: Micromoles = (micrograms / molecular weight) If you provide the molecular weight of the substance, I can help you calculate the number of micromoles in 20 micrograms.
The formula of 20 moles of sodium chloride?
The chemical formula of sodium chloride is NaCl; formula is not dependent from the number of moles. Because the molecular mass of NaCl is 57,958 622 382, the mass of 20 moles is 1159,172 447 64.
Are the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
Are all the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
How many Hydrogen atoms are in an Alkane with 7 Carbon atoms?
Alkanes have the general formula of CnH2n+2 so for 12 carbons, that would be 2x12 + 2 = 26 hydrogen atoms.
How do you calculate the molecular formula of a substance which contain 80 percent C and 20 percent H?
You can only calculate the empirical formula because you do not have a mass of this compound given. To do the empirical formula assume 100 grams and change percent to grams. Get moles. 80 grams Carbon (1 mole C/12.01 grams) = 6.66 moles C 20 grams hydrogen (1 mole H/1.008 grams) = 19.84 moles H the smallest becomes 1 in the empirical formula and the other number is divided by it, Thus; H/C 19.84 moles H/6.66 moles C = 2.9, which we call 3 so, CH3 --------------- is the empirical formula To get the molecular formula tour question needed to read; How to calculate molecular formula from such ans such mass of compound with these percentages of elements, Which, of course, your question did not provide. Then you would have divided that given mass by the mass total of the elements of the empirical formula, got a whole number by which you would have multiplied the numbers of your empirical formula to get molecular formula.
