0
What else can I help you with?
How many hydrogens in eicosane?
Eicosane is a straight-chain alkane with the chemical formula C20H42. This means it contains 20 carbon atoms and 42 hydrogen atoms. Therefore, eicosane has 42 hydrogen atoms in total.
How many protons are in C6H8O6?
The molecular formula C6H8O6 contain 20 atoms.
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
What is the gram molecular mass of a compound if 5 moles of the compound has a mass of 100 grams?
To find the gram molecular mass of the compound, you can use the formula: mass = moles × gram molecular mass. Given that 5 moles of the compound have a mass of 100 grams, you can rearrange the formula to find the gram molecular mass: gram molecular mass = mass / moles. Thus, gram molecular mass = 100 grams / 5 moles = 20 grams per mole.
Are all the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
How many hydrogens in eicosane?
Eicosane is a straight-chain alkane with the chemical formula C20H42. This means it contains 20 carbon atoms and 42 hydrogen atoms. Therefore, eicosane has 42 hydrogen atoms in total.
How many hydrogens are present on an alkane with 20 carbons?
An alkane with 20 carbons will have 42 hydrogens. This can be calculated using the formula 2n+2, where n is the number of carbons (C) in the alkane. So for an alkane with 20 carbons, the number of hydrogens would be 2(20) + 2 = 42.
How many protons are in C6H8O6?
The molecular formula C6H8O6 contain 20 atoms.
What is the molecular formula for turpentine?
Turpentine is a mixture of hydrocarbons just like kerosene oil it contains hydrocarbons having carbon atoms 11 to 20 or more
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
What is phenolphthalein molecular weight?
It has the molecular formula C20 H14 O4. Thus its Mr is (12*20+1*14+16*4) or 318.
How many micromoles is 20 micrograms?
To convert micrograms to micromoles, you need to know the molecular weight of the substance. The formula to convert micrograms to micromoles is: Micromoles = (micrograms / molecular weight) If you provide the molecular weight of the substance, I can help you calculate the number of micromoles in 20 micrograms.
The formula of 20 moles of sodium chloride?
The chemical formula of sodium chloride is NaCl; formula is not dependent from the number of moles. Because the molecular mass of NaCl is 57,958 622 382, the mass of 20 moles is 1159,172 447 64.
Are the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
What is the gram molecular mass of a compound if 5 moles of the compound has a mass of 100 grams?
To find the gram molecular mass of the compound, you can use the formula: mass = moles × gram molecular mass. Given that 5 moles of the compound have a mass of 100 grams, you can rearrange the formula to find the gram molecular mass: gram molecular mass = mass / moles. Thus, gram molecular mass = 100 grams / 5 moles = 20 grams per mole.
Are all the molecular formulas for all the amino acids the same?
no there r 20 different kinds of amino acids which differ from each other in chemical formula. all 20 amino acids have same NH2,H and COOH group, attached with C but they have different side chains due to which they are different in molecular formula..... Dr danial quddus.
What is C20 H42?
C20H42 is a chemical compound known as eicosane, which is an alkane with a straight-chain structure consisting of 20 carbon atoms and 42 hydrogen atoms. It is a waxy solid at room temperature and is commonly found in various natural sources, including certain plants and the cuticles of some insects. Eicosane is often used in laboratories and industries for applications such as lubricants and as a standard in the study of hydrocarbons.
