0
What else can I help you with?
What is the molecular formula of CTAB?
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
What is the molecular geometry of OSF4?
The molecular geometry of OSF4 is square pyramidal.
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na
What is the molecular geometry of Trinitrotoluene around each central atom?
Trinitrotoluene TNT is an aromatic compound. Four groups are attached to the central benzene ring, one -CH3, and three -NO2 along with two hydrogen atoms. Each is attached to an sp2 hybridised carbon so the molecular geometry of each carbon atom is trigonal planar with a bon angle of 120 0
How much isomers does c5h10 have?
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
What is the molecular geometry of CH3 plus?
Trigonal Planar
What is the molecular geometric shape of CH3CHO?
CH3-CHO, or ethanol, is made up of the tetrahedral CH3- and trigonal planar -CHO. Because it is a molecule made up of different parts with independent geometries, it doesn't have its own definitive geometry. To make a geometry for every such molecule would be a very complex process.
What is the molecular formula of CTAB?
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
What is the molecular geometry of SCl6?
The molecular geometry is octahedral.
What is the molecular geometry of C2H2Br2?
The molecular geometry of C2H2Br2 is trigonal planar.The molecular geometry of C2H2Br2 is trigonal planar.
What is the molecular geometry of secl2?
The molecular geometry of secl2 is BENT.
What is the molecular geometry of HClO?
The molecular geometry of HClO is bent.
What is the molecular geometry of N2O2?
The molecular geometry of N2O2 is linear.
What is molecular geometry of CH2?
It will be trigonal planar in terms of electron domain geometry, and bent in terms of molecular geometry. Carbon will form a single bond with each hydrogen atom, and will have 2 electrons left over. A molecule with 2 bonding domains, and one non-bonding domain takes on a bent shape.
What is the electron geometry of CH3 plus?
Trigonal Planar
What is the molecular shape of CH3?
Trigonal planar.
What is the molecular geometry of IF4?
The molecular geometry of IF4- is square planar.
