it is a trigonal planar....a trigonal planar is when you have 4 atoms. 3 atoms surround one atom(central atom, in this case C).
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
The molecular geometry of OSF4 is square pyramidal.
What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na
Trinitrotoluene TNT is an aromatic compound. Four groups are attached to the central benzene ring, one -CH3, and three -NO2 along with two hydrogen atoms. Each is attached to an sp2 hybridised carbon so the molecular geometry of each carbon atom is trigonal planar with a bon angle of 120 0
yes it have two isomer CH3.CH2.CH=CH-CH3, and CH3-CH=C-CH3 ! CH3 BY ATIF JUTT
Trigonal Planar
CH3-CHO, or ethanol, is made up of the tetrahedral CH3- and trigonal planar -CHO. Because it is a molecule made up of different parts with independent geometries, it doesn't have its own definitive geometry. To make a geometry for every such molecule would be a very complex process.
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
The molecular geometry is octahedral.
It will be trigonal planar in terms of electron domain geometry, and bent in terms of molecular geometry. Carbon will form a single bond with each hydrogen atom, and will have 2 electrons left over. A molecule with 2 bonding domains, and one non-bonding domain takes on a bent shape.
The molecular geometry of secl2 is BENT.
The molecular geometry of HClO is bent.
The molecular geometry of N2O2 is linear.
Trigonal Planar
Trigonal planar.
The molecular geometry of IF4- is square planar.
The molecular geometry of NHF2 is trigonal pyramidal.