0
What else can I help you with?
Are methylpropyl ether and 3-methyl-2-butanol isomers?
No, methylpropyl ether (CH3OC3H7) and 3-methyl-2-butanol (C5H12O) are not isomers. Methylpropyl ether is an ether compound, while 3-methyl-2-butanol is an alcohol with a different molecular formula and structure.
What form of carbon has a ratio of 2-1-1?
The structure with a 2-1-1 ratio of carbon atoms is propyne (molecular formula C3H4), which has two carbon atoms, one hydrogen atom bonded to each of the carbon atoms, and one additional hydrogen atom attached to a terminal carbon atom.
What is the formula for red 40?
Red 40 is disodium 6-hydroxy-5-((2-methoxy-5-methyl-4-sulfophenyl)azo)-2-naphthalenesulfonate with the chemical formula C18H14N2Na2O8S2.
How many isomers for C5H11OH and their structure?
There are five isomers for C5H11OH. They include n-pentanol, isopentanol, neo-pentanol, 2-methyl-1-butanol, and 3-methyl-1-butanol.
Why concentrated acid is used in dehydration of 2-methyl-2-butanol?
2-methyl-2-butene is the major product (85%), while 2-methyl-1-butene the minor (15%) in an E1 reaction.
What is the chemical formula for 2-methyl-2-butanol?
The chemical formula of 2-methyl-2-butanol is C15H12O.
What is the mistake in the iupac name of 2 methyl 3 propyne?
The 3 in front of the propyne means that the triple bond is between the 3rd and 4th carbon of the longest carbon chain in the molecule. However, you only have 3 carbons in a chain.
What is the molecular formula for 2-methyl-1-propanol?
The molecular formula for 2-methyl-1-propanol is C4H10O.
Isomer of ketone with formula C5H10O?
2-hexanone3-hexanone2-methyl-3-pentanone3-methyl-2-pentanone4-methyl-2-pentanone3,3-dimethyl-2-butanone
Are methylpropyl ether and 3-methyl-2-butanol isomers?
No, methylpropyl ether (CH3OC3H7) and 3-methyl-2-butanol (C5H12O) are not isomers. Methylpropyl ether is an ether compound, while 3-methyl-2-butanol is an alcohol with a different molecular formula and structure.
Structural formula of 3-chloro 2-methyl 1-butanol?
A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.
How many number of pi bond in propyne?
there are 2 pi bonds and 1 sigma bond in propyne (alkynes)
How do you write the molecular formula for 2-methyl-1-butanol?
C5H12o
What is the displayed formula of 2-methylpentane?
The displayed formula of 2-methylpentane can be represented as follows: CH3 | CH3-CH-CH2-CH3 In this structure, a methyl (CH3) group is attached to the second carbon of a five-carbon straight-chain alkane (pentane). The full molecular formula for 2-methylpentane is C6H14.
How many different isomers are possible for hydrocarbon with the molecular formula C4H10?
The alcohols having the formula C4H10O are four 1-butanol , 2-butanol, 2-methyl-1-propanol and 2-methyl-2-propanol.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What structure is obtained by hydroboration-oxidation of 2-methyl propene?
The hydroboration-oxidation of 2-methylpropene results in the formation of 2-methylpropan-2-ol, also known as tert-butanol. This alcohol has a tertiary alcohol functional group attached to a methyl group.
