answersLogoWhite

0

Please see the related link for an image

User Avatar

Wiki User

12y ago

What else can I help you with?

Continue Learning about Natural Sciences

Why 3-pentanone does not give positive iodoform test?

3-Pentanone does not give a positive iodoform test because it lacks the necessary structure. The iodoform test specifically requires the presence of a methyl ketone (a ketone with a methyl group adjacent to the carbonyl), which 3-pentanone does not have; its structure is CH3(CH2)3COCH3. Instead, it features a propyl group adjacent to the carbonyl, preventing the formation of iodoform (CHI3) upon reaction with iodine and a base.


What is the Molecular mass of 2-pentanone?

The molecular mass of 2-pentanone (C5H10O) is 86.13 g/mol.


How can you distinguish between 1-propanol and 3-pentanone by means of a chemical reaction?

1-Propanol and 3-pentanone can be distinguished using the oxidation test with potassium dichromate (K2Cr2O7). 1-Propanol, a primary alcohol, will oxidize to form propanoic acid, resulting in a color change from orange to green. In contrast, 3-pentanone, a ketone, is resistant to oxidation under these conditions and will not produce a color change. This difference in reactivity allows for the identification of the two compounds.


2-pentanone to 2-pentanol distinguish?

2-pentanone is a ketone with a carbonyl group attached to a five-carbon chain, while 2-pentanol is an alcohol with the -OH group attached to the same five-carbon chain. 2-pentanone has a carbonyl group, giving it a characteristic ketone odor. 2-pentanol is an alcohol, making it more polar and having different physical properties compared to 2-pentanone.


What is the condensed structural formula for 4-bromo-2-pentanone?

The formula is C5H9BrO.

Related Questions

Why 3-pentanone does not give positive iodoform test?

3-Pentanone does not give a positive iodoform test because it lacks the necessary structure. The iodoform test specifically requires the presence of a methyl ketone (a ketone with a methyl group adjacent to the carbonyl), which 3-pentanone does not have; its structure is CH3(CH2)3COCH3. Instead, it features a propyl group adjacent to the carbonyl, preventing the formation of iodoform (CHI3) upon reaction with iodine and a base.


What is the structure of pentanone?

Please see the related link for an image


What is the structural formula of 3 pentanone?

Ch3ch2coch2ch3


Are 2-pentanone and 3-pentanone are isomers?

They are metamers but not position isomers


What is the structure of 2-pentanone?

CH3-CH(=O)-CH(CH3)-CH2-CH3


Would a 2-pentanone give a positive reaction to Iodoform test?

No, 2-pentanone would not give a positive reaction to the Iodoform test. The Iodoform test is specific for methyl ketones (ketones with a methyl group adjacent to the carbonyl), and 2-pentanone does not have this structure. Instead, it has a butyl group adjacent to the carbonyl, which does not lead to the formation of iodoform.


What is the commonname of pentanone?

mthyl propyl keton


What are the chemical tests to distinguish between 2 pentanone and 3 pentanone?

Do an iodoform test. Use an aqueous solution of iodine and potassium iodide added to basic solutions of 2-pentanone and 3-pentanone.The iodoform reaction is a classical test for methyl ketones. A light-yellow precipitate of iodoform forms immediately with the methyl ketone of 2-pentanone.To confirm:1H NMR3-pentanone will show only 2 signals: a triplet at ~1.33 and a quartet at ~2.352-pentanone will show 4 signals: a triplet at ~0.90, a sextet at ~1.55, a singlet at ~2.05 and a triplet at ~2.40


What chemicals contain 2-pentanone?

2-pentanone IS a chemical. One place it's found is in tobacco.


What is the Molecular mass of 2-pentanone?

The molecular mass of 2-pentanone (C5H10O) is 86.13 g/mol.


How can you distinguish between 1-propanol and 3-pentanone by means of a chemical reaction?

1-Propanol and 3-pentanone can be distinguished using the oxidation test with potassium dichromate (K2Cr2O7). 1-Propanol, a primary alcohol, will oxidize to form propanoic acid, resulting in a color change from orange to green. In contrast, 3-pentanone, a ketone, is resistant to oxidation under these conditions and will not produce a color change. This difference in reactivity allows for the identification of the two compounds.


2-pentanone to 2-pentanol distinguish?

2-pentanone is a ketone with a carbonyl group attached to a five-carbon chain, while 2-pentanol is an alcohol with the -OH group attached to the same five-carbon chain. 2-pentanone has a carbonyl group, giving it a characteristic ketone odor. 2-pentanol is an alcohol, making it more polar and having different physical properties compared to 2-pentanone.