0
Pyridine itself (unsubstituted) is basic due to presence of lone pare of electron on nitrogen atom which is not involved in aromatic character , methyl at 4th (Para) position is electron donor due to hyper-conjugation so electrons density at nitrogen becomes increase so 4-methyl pyridine is more basic as compare to unsubstituted pyridine.
What else can I help you with?
What is the best route for synthesis of pyridine-4-acetaldehyde?
What is the best route for synthesis of pyridine-4-acetaldehyde?
What is the action of caustic soda on colour of phenolphtalein?
Basic materials and any weak acid solution with pH above 4 turn Methyl Orange into orange-yellow
What is the total number of carbon atoms in a molecule of 2 methyl and 4 ethyloctane?
The molecule 2-methyl and 4-ethyloctane has 10 carbon atoms in total. This consists of 2 carbon atoms in the methyl group and 8 carbon atoms in the octane chain.
3 methyl 4 chloro hexane?
3-methyl-4-chlorohexane is a compound with six carbon atoms in a chain, a chlorine atom attached to the fourth carbon, and a methyl group attached to the third carbon. It is an alkyl halide, a type of organic compound.
Is pH 9 more acidic than pH 4?
No, pH 9 is actually more basic (alkaline) than pH 4. The pH scale is logarithmic, so each unit is 10 times more acidic or basic than the unit next to it. pH 4 is more acidic than pH 9.
What is the best route for synthesis of pyridine-4-acetaldehyde?
What is the best route for synthesis of pyridine-4-acetaldehyde?
Why methyl amine is a stronger base than ammonia?
Because methyl is an electron pumping group and It pumps electrons to Amine group to make it basic, But Ammonia has no influence from any basic groups. Therefore compared to Methyl-Amine, Ammonia is less basic
Colour of methyl orange in sodium hydroxide?
acids wont change their color in methyl orange. bases changes the color when they are present in methyl orange.HCl is white or no color in methyl orange.Added:Red > orangy-yellow
What is Karl fischer composition?
The main contents of karlfisher reagents are 1.Dichloro methane 2.Iodine 3.So2 4.Pyridine in latest stage the pyridine is replaced by Immidazole
What is the structure of 4-methyl-4-nonene?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the action of caustic soda on colour of phenolphtalein?
Basic materials and any weak acid solution with pH above 4 turn Methyl Orange into orange-yellow
What is the IUPAC name of cresol?
o Cresol 2-methyl phenol m Cresol 3-methyl phenol p- Cresol 4- methyl phenol
What is the scientific name of the methyl orange?
IUPAC name for methyl orange is: 4-dimethylaminoazobenzene-4'-sulfonic acid sodium saltformula: C14H14N3NaO3SOther name: p-dimethylamino-azobenzenesulfonic acidStructural formula of Methyl Orange can be viewed in 'Related links' just below this answer page.
What is the of 4 4?
4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.
What is the total number of carbon atoms in a molecule of 2 methyl and 4 ethyloctane?
The molecule 2-methyl and 4-ethyloctane has 10 carbon atoms in total. This consists of 2 carbon atoms in the methyl group and 8 carbon atoms in the octane chain.
What is the dehydration of 4 methylcyclohexanol?
The dehydration of 4-methylcyclohexanol yields only one product, 4-methylcyclohexene. --Ron Actually, at least three different isomers of methyl cyclohexene are produced. 1 methyl cyclohexene, 3-methyl cyclohexene and 4-methyl cyclohexene. It is a fascinating reaction undergoing a lot of recent study. It is becoming the classic example of the "Evelyn Effect" wherin the proportions of different products of a reaction vary with time as a result of the fact that the rates of the processes generating the different products differ in themselves. See http://ochemonline.pbwiki.com/f/Dehydration_Blog.doc for more information. - GM
What will be the no of chiral compounds after mono chlorination of 2 Methyl butane?
4
