An example of dehydration synthesis would be two monosaccharide's joining together. For example, glucose and fructose. Another word for synthesis is combination.
CaO + CO2 - CaCO3
Ammonia is synthesised for use as a fertilizer N2 + 3H2 = 2NH3
Dioctyl Maleate is synthesised for use in dispersants by reacting 2 ethyl hexyl alcohol with maleic anhydride
2 CH3CH(C2H5)CH2CH2CH2CH2OH + CH(CO)O(CO)CH = Dioctyl Maleate + H2O
A reportER writing about a series of related crimes
Laura asks some of her friends what they think of a new restaurant
Sally asks her friends if she should see the movie they watched last night
or
Layton asks Mark and James which music they listen to.
A synthesis reaction is when 2 elements react to form 1 compound. For example, 2Ca + O2 -> 2CaO ; 2H2 + O2 -> 2H2O
the production of enzymes by activity including combining chemicals, which is the definition of synthesis.
No, synthesis is the breaking of bonds that forms water, while dehydration synthesis is the breaking of bonds by removing water
Tissue synthesis is toilet paper with a mind!
The site for protein synthesis is a cell structure. The specific structure in which synthesis occurs is the ribosomes, which is in the cytoplasm.
Lipid synthesis is a process that makes and dissolves lipids. It consists of 2 phases fatty synthesis and lipid assembly.
An example of dehydration synthesis would be two monosaccharide's joining together. For example, glucose and fructose. Another word for synthesis is combination.
rust
CaO + CO2 - CaCO3
Generally, a synthesis reaction is as follows; A + B > ABAn example of such is the synthesis of potassium chloride from potassium (solid) and chlorine gas: 2K + Cl2> 2KCl
phosphorylase
H2+Br2 2HBr
The polymerization process is an example.
Williamson's synthesis an example of nucleophilic substitution rxn, in this rxn an alkyl halide is allowed to react with a Na alkokide.
The adjective form for the noun synthesis is synthetic. Example use: Synthetic flowers don't need to be watered.
synthesis reaction
H2+Br2--->2HBr
CaO + CO2 - CaCO3