0
octane
Wiki User
∙ 15y ago
Wiki User
∙ 14y ago3-heptyne
Add your answer:
Earn +20 pts
What is the name of the following organic compound rm ch 3ch 2ccch 2ch 2ch 3?
What is the name of the following organic compound?
What is the molecular structure of 3-methylpentane?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
What is the structure of 2-methylpentan-3-ol?
ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3
What does the crochet term 3ch mean?
It means to make 3 chain stitches.
CH 3 - CH 2- CH 2- CH 3 - CH 2- CH 2- CH 3?
17
Molecular formula of hexane?
The molecular formula of all the hexanes is C6H14. (Remember the numbers should be subscripts.) However there are isomers: CH3CH2CH2CH2CH2CH3, (CH 3 ) 2 CH(CH 2 ) 2 CH 3 CH 3 CH 2 CH(CH 3 )CH 2 CH 3 CH 3 CH(CH 3 )CH(CH 3 )CH 3 CH 3 C(CH 3 ) 2 CH 2 CH 3 Wikipedia shows them clearly.
What is condensed formula for 2 3 3 4 tetramethylnonane?
Ch3ch(ch3)c(ch3)2ch(ch3)(ch2)4ch3
What are the ratings and certificates for Necessary Roughness - 2011 Ch-Ch-Changes 3-1?
Necessary Roughness - 2011 Ch-Ch-Changes 3-1 is rated/received certificates of: Netherlands:6
Lipids molecular formula?
That depends on the lipid. There are hundreds, if not thousands.
How do you bridge a 4 channel amp to 2 channels?
positive of ch 1 and negative of ch 2...........The positive of ch 3 and negative of ch 4.
What is the difference between 2-hexene and 3-hexene?
The position of double bond is different. CH3-CH=CH-CH2-CH2-CH3 is 2-hexene CH3-CH2-CH=CH-CH2-CH3 is 3-hexene
What is ch 3 in knitting terms?
Ch 3 means make three chains, but is a crochet rather than a knitting term.
