h
|
h - c- h
|
h - c- h
|
c=c-c-c-c=c-c
the rest of the h's are common sense to fill in but i dont have space
ok, don't think the structure is compatible here. that ethyl group should be on the 4th carbon in the horisontal chain
CH3-C=C(CH3)-C(CH2-CH3)-CH2-CH2-CH3
The () indicate groups which are substituents to the associated carbons
CH2=CHCH2CH(C2H5)CH=CHCH3
c7 H14
ch3cooc2h5
The structure for 2-bromo-3-methyl-3-heptanol looks as follows: First draw a heptane chain. Single bond a bromine to the 2nd carbon. single bond a methyl group to the 3 carbon. Single bond a hydoxyl group to the third carbon as well.
CH3-CH(CH3)-CH2-CH2-CH3, 2-methylpentane
Basically, it's a hexene molecule (6 carbons, C-C-C-C-C=C, the double bond comes from it being an ALKENE, this is obvious from the -ene on the end of the word hexene) with two(di-) methyl groups on it (Methyl being CH3). the numbers describe where exactly the methyl groups and hexene double bond are located on the structure. If you number each carbon 1 to 6 from right to left, you know which carbon to put the methyls on (3-4). The 2 states where the double bond is located, which is between carbon 2 and 3. Here's an example. C1-C2=C3-C4-C5-C6 Each number shows where exactly each substituent group goes. I put the double bond in at 2, the methyl groups (CH3) would be bonded by their carbon to carbons 3 and 4 on the hexene chain above. I am unable to draw an example of this molecule's shape and I can't find a picture of it on the internet but so long as you draw in a methyl group on carbon's 3 and 4 in the numbered Hexene chain above, you should have the correct structure. Hope this helped.
Firstly you must draw the pentagon then you count the number start at downward. Then you write CH3 for second and C6H5 for third place
To begin with, octane is a chain of 8 carbons. If you were to draw these eight carbons in a row and number them 1-8, then the numbers corresponding to the substituents (chloro, ethyl and methyl) will show you where to put them. Off of the fifth carbon from one end (make sure you are consistent with which end you use!) is Cl Off of the third carbon is the ethyl group (CH2-CH3) and off of the fourth is the methyl group (CH3)
ch3cooc2h5
If they draw an Ethyl level, yes.
The structure for 2-bromo-3-methyl-3-heptanol looks as follows: First draw a heptane chain. Single bond a bromine to the 2nd carbon. single bond a methyl group to the 3 carbon. Single bond a hydoxyl group to the third carbon as well.
CH3-CH(CH3)-CH2-CH2-CH3, 2-methylpentane
Basically, it's a hexene molecule (6 carbons, C-C-C-C-C=C, the double bond comes from it being an ALKENE, this is obvious from the -ene on the end of the word hexene) with two(di-) methyl groups on it (Methyl being CH3). the numbers describe where exactly the methyl groups and hexene double bond are located on the structure. If you number each carbon 1 to 6 from right to left, you know which carbon to put the methyls on (3-4). The 2 states where the double bond is located, which is between carbon 2 and 3. Here's an example. C1-C2=C3-C4-C5-C6 Each number shows where exactly each substituent group goes. I put the double bond in at 2, the methyl groups (CH3) would be bonded by their carbon to carbons 3 and 4 on the hexene chain above. I am unable to draw an example of this molecule's shape and I can't find a picture of it on the internet but so long as you draw in a methyl group on carbon's 3 and 4 in the numbered Hexene chain above, you should have the correct structure. Hope this helped.
draw internal leaf
Firstly you must draw the pentagon then you count the number start at downward. Then you write CH3 for second and C6H5 for third place
draw the organization structure of university
c4h10o
No, it has only one possible structure. That structure is CH2= CHCl .
H-O-Cl