0
How do you write the condensed structural formula for 14-diclorocyclohexane?
Wiki User
∙ 8y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
Why doesn't ethanone exist?
If you write out is's structural formula you will see that it's just ethanal (aldehyde) as there are nor enough carbons for it to be ethanone.
Chemical formula for liquid ammonia?
Liquid ammonia can refer to: a) Ammonia dissolved in water solution, forming Ammonium hydroxide = NH4OH b) Ammonia condensed to its liquid state = NH3(L) [Write the L in lower case]
How do you write the formula for sodium chlorate?
Formula: NaClO3
Write the chemical formula for calcium phosphide?
Formula: Ca3P2
What is a quick way of showing the chemical composition of a compound?
draw a structural formula for organics, write a chemical formula (molecular formula or ionic formula) for simpler compounds.
What is a quick way of showing the chemical composition in a compound?
draw a structural formula for organics, write a chemical formula (molecular formula or ionic formula) for simpler compounds.
What is the structural formula of hemoglobin?
C738 H1166 N812 O203 S2 Fe is the chemical formula for the majority of it. There are several different formulae for haemoglobin. The structural would probably take about a week to write out.
What is the structural formula for 5-heptyne?
Assuming that the questioner intended to write 5,5-dimethyl-2-heptyne, a semi-structural formula that can be written with the limited character set available is C2H5C(CH3)2CH2C=CCH3.
What is the structural formula for 5-dimethyl-2-heptyne?
Assuming that the questioner intended to write 5,5-dimethyl-2-heptyne, a semi-structural formula that can be written with the limited character set available is C2H5C(CH3)2CH2C=CCH3.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
Why doesn't ethanone exist?
If you write out is's structural formula you will see that it's just ethanal (aldehyde) as there are nor enough carbons for it to be ethanone.
How many repeating units are in a polymer?
there is no limit the name of the polymer should tell you write the structural formula for the monomer until all of the atoms are used
How do you write 3-pentanol in condensed form?
C3H8O1
What is the chemical formula for cloudy ammonia?
NH3(aq) in water droplets (mist, condensed).(Though some prefer to write down NH4OH, this is not the formula of a constant arrangement, any value of n from 0 till 6 will do in NH3.nH2O, not only n=1)
A chemical compound containing three double bonds?
Ethyne, also called acetylene has the formula C2H2 and the structural formula of H-C≡C-H. Ethene has the formula C2H4 and the structural formula of H2C=CH2.
Chemical formula for liquid ammonia?
Liquid ammonia can refer to: a) Ammonia dissolved in water solution, forming Ammonium hydroxide = NH4OH b) Ammonia condensed to its liquid state = NH3(L) [Write the L in lower case]
