answersLogoWhite

0

How does Pb 2 plus become Pb 4 plus?

User Avatar

Anonymous

∙ 14y ago
Updated: 8/18/2019

a peanut buter and jelly or jam sandwich

User Avatar

Wiki User

∙ 14y ago

What else can I help you with?

Related Questions

What is the total number of electrons in an Pb plus 4?

Pb which is neutral has 82 electrons. Thus, if it has a 4+ charge, then it has 78 electrons.


What do you get when you mix Pb plus 4 and OH-1?

When you mix Pb2+ and OH-, they will react to form a precipitate of lead (II) hydroxide, which has the chemical formula Pb(OH)2. This is an insoluble compound that will form a solid or a cloudy solution.


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


What is the chemical formula for plumbic hydroxide?

The formula for Plumbic carbonate is Pb(CO3)2 because the higher charge of lead has a charge of 4+ and CO3 has a charge of 2-, therefore the charges would diagonally switch and then be reduced to the simplest whole-number ratio.


How to balance Pb plus pbo2 plus h2so4 H2O plus pbso4?

To balance the chemical equation Pb + PbO2 + H2SO4 → H2O + PbSO4, start by balancing the Pb atoms on the left side by adding a coefficient of 2 in front of Pb on the left side. Then balance the SO4 atoms by adding a coefficient of 4 in front of H2SO4. The balanced equation is 2Pb + PbO2 + 4H2SO4 → 2H2O + 2PbSO4.


What is the correct formula formed from lead(Pb) plus 4 and Oxygen(O)-2?

The chemical formula of lead tetroxide is Pb3O4.


What is the formula for ionic compound formed between S2- and PB4 plus?

The formula for the ionic compound formed between S^2- and Pb^4+ is PbS2, where lead (Pb) has a 4+ charge and sulfur (S) has a 2- charge. This results in the compound lead(IV) sulfide.


What's oxidation number of pb?

0 in the elemental form, +2 or +4 in its compounds


What is the formula for lead II chlorite?

Pb(ClO3)4


What is the charge of Pb?

The charge of lead (Pb) can vary depending on the compound it is in. Common charges for lead include +2 and +4.


What is the chemical formula for lead(IV)bicarbonate?

Pb(OH)4 Hydroxide ion has a charge of -1. Since the lead has a charge of +4, you need four hydroxide ions to keep the compound stable


Pb2 plus yields Pb4 plus is this oxidation or reduction?

This is oxidation. The Pb ion is going from a +2 oxidation state to a +4 oxidation state, which means it is losing electrons and being oxidized.