answersLogoWhite

0

You will get Pb(OH)4

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

How does Pb 2 plus become Pb 4 plus?

a peanut buter and jelly or jam sandwich


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


What is the total number of electrons in an Pb plus 4?

Pb which is neutral has 82 electrons. Thus, if it has a 4+ charge, then it has 78 electrons.


How to balance Pb plus pbo2 plus h2so4 H2O plus pbso4?

To balance the chemical equation Pb + PbO2 + H2SO4 → H2O + PbSO4, start by balancing the Pb atoms on the left side by adding a coefficient of 2 in front of Pb on the left side. Then balance the SO4 atoms by adding a coefficient of 4 in front of H2SO4. The balanced equation is 2Pb + PbO2 + 4H2SO4 → 2H2O + 2PbSO4.


When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?

Your formulas are not correct.


What is the chemical formula for lead 4 acetate?

The chemical formula for lead(IV) acetate is Pb(C2H3O2)4.


What is the formula for lead (IV) acetate?

The chemical formula of lead acetate is Pb(CH3COO)4.


What is the chemical formula for lead(IV)bicarbonate?

Pb(OH)4 Hydroxide ion has a charge of -1. Since the lead has a charge of +4, you need four hydroxide ions to keep the compound stable


What is the periodic symbol 4 lead?

The periodic symbol for lead is Pb.


What is the compound name for Pb(OH)4?

The compound name for Pb(OH)4 is lead(IV) hydroxide.


What is the formula for ionic compound formed between S2- and PB4 plus?

The formula for the ionic compound formed between S^2- and Pb^4+ is PbS2, where lead (Pb) has a 4+ charge and sulfur (S) has a 2- charge. This results in the compound lead(IV) sulfide.


What is the chemical formula for plumbic hydroxide?

The formula for Plumbic carbonate is Pb(CO3)2 because the higher charge of lead has a charge of 4+ and CO3 has a charge of 2-, therefore the charges would diagonally switch and then be reduced to the simplest whole-number ratio.