0
What else can I help you with?
What is the periodic symbol 4 lead?
The periodic symbol for lead is Pb.
Why Pb2 plus is more stable than Pb4 plus?
Pb2+ is more stable than Pb4+ because the 6s and 6p orbitals in Pb have poor shielding ability, making it energetically unfavorable for Pb to lose 4 electrons and achieve the 4+ oxidation state. The higher charge of Pb4+ leads to greater electron-electron repulsions, making it less stable than Pb2+.
What is the formula formed between pb4 plus and po3- ions?
Pb3(PO)4 would be the correct answer but it isn't because this compound does NOT exsist: Pb3(PO4)4 or Pb3(PO3)4 are possible phosphate and phosphite salt of Pb(4+) ions.
What is the symbol and charge of a lead ion?
The symbol for a lead ion is Pb, and the charge can vary depending on the specific ion. Common lead ions include Pb^2+ and Pb^4+.
What is the Oxidation state of Pb in PbO2?
The oxidation state of Pb in PbO2 is +4. In this compound, oxygen is generally assigned an oxidation state of -2 and since there are two oxygen atoms, the total oxidation state contributed by oxygen is -4. To balance the charge for the compound, the lead atom must have an oxidation state of +4.
How does Pb 2 plus become Pb 4 plus?
a peanut buter and jelly or jam sandwich
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the total number of electrons in an Pb plus 4?
Pb which is neutral has 82 electrons. Thus, if it has a 4+ charge, then it has 78 electrons.
How to balance Pb plus pbo2 plus h2so4 H2O plus pbso4?
To balance the chemical equation Pb + PbO2 + H2SO4 → H2O + PbSO4, start by balancing the Pb atoms on the left side by adding a coefficient of 2 in front of Pb on the left side. Then balance the SO4 atoms by adding a coefficient of 4 in front of H2SO4. The balanced equation is 2Pb + PbO2 + 4H2SO4 → 2H2O + 2PbSO4.
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
What is the chemical formula for lead 4 acetate?
The chemical formula for lead(IV) acetate is Pb(C2H3O2)4.
What is the formula for lead (IV) acetate?
The chemical formula of lead acetate is Pb(CH3COO)4.
What is the chemical formula for lead(IV)bicarbonate?
Pb(OH)4 Hydroxide ion has a charge of -1. Since the lead has a charge of +4, you need four hydroxide ions to keep the compound stable
What is the periodic symbol 4 lead?
The periodic symbol for lead is Pb.
What is the compound name for Pb(OH)4?
The compound name for Pb(OH)4 is lead(IV) hydroxide.
What is the formula for ionic compound formed between S2- and PB4 plus?
The formula for the ionic compound formed between S^2- and Pb^4+ is PbS2, where lead (Pb) has a 4+ charge and sulfur (S) has a 2- charge. This results in the compound lead(IV) sulfide.
What is the chemical formula for plumbic hydroxide?
The formula for Plumbic carbonate is Pb(CO3)2 because the higher charge of lead has a charge of 4+ and CO3 has a charge of 2-, therefore the charges would diagonally switch and then be reduced to the simplest whole-number ratio.
