0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Can C7H14 contain rings?
Yes, it can. A molecule with the formula C7H14 is monounsaturated, so it can form an alkene or a cycloalkane with a single ring. Possible isomers include cycloheptane and methylcyclohexane.
Two molecules that have the same formulas but different structures are said to be isomers Draw acceptable Lewis structures for two isomers of S2F2?
carbon is small molecule
How many hydrogen atoms are in Heptene?
Heptene is C7H14 so the answer is 14.
Why are CH3CH2COOH and CH3CHOHCHO optical isomers?
These are not optical isomers they are functional group isomers a subcategory of structural isomers.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
Can C7H14 contain rings?
Yes, it can. A molecule with the formula C7H14 is monounsaturated, so it can form an alkene or a cycloalkane with a single ring. Possible isomers include cycloheptane and methylcyclohexane.
Two molecules that have the same formulas but different structures are said to be isomers Draw acceptable Lewis structures for two isomers of S2F2?
carbon is small molecule
What are examples of isomers of C7 H14?
Answer ...There are 5 structural isomers of C6H14. The structural names are: hexane, 2-methylpentane, 3-methylpentane, , 2,3-dimethylbutane and 2,2-dimethylbutane.
How do you determine the structural isomers of C6h14?
Just try to draw the structures with different arrangements of carbon atoms having four valencies each, there are 5 isomers for this formula.
Draw the two geometrical isomers of chloroaquotetrammine cobalt 2 chloride?
Lewis structure for cobalt chlorit
How do you draw CH2Br2?
C4H8O has alot of isomers but propan-2-ol is one. google it for the structure (:
Draw all possible isomers of heptyne?
Paul mackie is a fool he is a waste of space. he has no mates. everyone wishes he is not born. he is a looser. rot to the core of the earth and you will burn and no more him
What type of reaction is C16H34 - C7H14 plus C9H20?
kraker
Are NaCl and C7H14 miscible?
Miscible is not the correct word - probable you think to soluble; and because NaCl is a polar compound it is not soluble in these organic compounds (the formula C7H14 correspond to three compounds).
How many hydrogen atoms are in Heptene?
Heptene is C7H14 so the answer is 14.
Why are CH3CH2COOH and CH3CHOHCHO optical isomers?
These are not optical isomers they are functional group isomers a subcategory of structural isomers.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
