0
No. The formula is for propane, not pentane. A pentane would have five carbon atoms, and this formula shows only three.
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
What is ch3-ch2-ch2-ch2-ch3?
This molecule is called 2-MethylHexane.Additional Information:2-MethylHexane is a common solvent and is often found under the names, ethylisobutylmethane and isoheptane, as well as some other less common names.
What is the nomenclature for ch3 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
OCTANE
What is ch3-ch2-ch2-ch2-ch2-ch3?
What is ch3-ch2-ch2-ch2-ch2-ch3 ???? If you mean CH3-CH2-CH2-CH2-CH2-CH3 , then it is Hexane. Note the use of CAPITAL letters. NB One letter elemental symbols are ALWAYS a CAPITAL letter. It is the internationally recognised standard. So Carbon is 'C' , not 'c' Similarly Hydrogen is 'H' , not 'h'.
What is the name for CH3 CH2?
pentane
What is the chemical formula is pentene?
Pentane is C5H12 The Structure is as follows. CH3-CH2-CH2-CH2-CH3
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
What is ch3-ch2-ch2-ch2-ch3?
This molecule is called 2-MethylHexane.Additional Information:2-MethylHexane is a common solvent and is often found under the names, ethylisobutylmethane and isoheptane, as well as some other less common names.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
Is n-pentane polar or nonpolar?
Heptane is non polar molecule. This molecule has only carbon and hydrogen.E.N difference between two atoms is 0.4,it is nearly equal to zero.
What is the nomenclature for ch3 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
OCTANE
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
What is lowest molicular formula of alkane which contains one chiral carbon?
2-ethylpentane as it the carbon carbon atom in the pentane backbone has four different groups such as -H, -CH3, -CH2-CH3 and -CH2-CH2-CH3. The molecule is still an alkane because it does not have any double bonds and is made of just carbon and hydrogen.
What type of reaction between chlorine and butane?
This reaction is of a substitution type by a 'alkyl-radical' mechanism:Cl2 + CH3-CH2-CH2-CH3 --> CH2Cl-CH2-CH2-CH3 + HClor (a bit more in favor)Cl2 + CH3-CH2-CH2-CH3 --> CH3-CHCl-CH2-CH3 + HCl
What is ch3-ch2-ch2-ch2-ch2-ch3?
What is ch3-ch2-ch2-ch2-ch2-ch3 ???? If you mean CH3-CH2-CH2-CH2-CH2-CH3 , then it is Hexane. Note the use of CAPITAL letters. NB One letter elemental symbols are ALWAYS a CAPITAL letter. It is the internationally recognised standard. So Carbon is 'C' , not 'c' Similarly Hydrogen is 'H' , not 'h'.
