0
2,2,3- trimethyl pentane has the structural shape.
CH3-C(CH3)2-CH(CH3)-CH2-CH3
C8H18 is the condensed /reduced formula.
lenpollock
Wiki User
∙ 13y agoC6h18
Add your answer:
Earn +20 pts
What is the condensed structure of a thiol?
RSH - condensed general formula of compound CH3SH - methyl thiol
What is the condensed stuctural formula for ethanol?
CH3CH2OH or C2H5OH
What is the condensed formula for 3-ethyl-2-methylpentane?
The condensed formula of 3-ethylpentane (CH2CH3)2CHCH2CH3 . Added: Another more trivial name is tri-ethyl methane CH(CH2CH3)3.
What is the condensed structural formula for ethyne?
the formula for the compound is C2H2 to express this in its simplest form devide each atom be a common number, here we can see that there is 2 of each atom so an emperical formula would be CH
Draw the condensed structural formula for 3-decyne?
Ch3ch2ch2ch2ch2ch2c=-cch2ch3
What is the condensed formula for ethanol?
The chemical formula of ethanol is C2H5OH.
What is the condensed structural formula of cyclohexane?
Cyclohexane which is a cycloalkanes, has a structural formula of C6H12. It may be written in a condensed form as (CH2)6.
What is the condensed formula for 5-isopropyl-2-methylheptane?
This formula is C11H24.
How does a complete structural formula differ from condensed formula?
The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.
What is the condensed structure of a thiol?
RSH - condensed general formula of compound CH3SH - methyl thiol
What is the condensed formula of Propanol?
C3H7OH C3H7OH
What is the condensed molecular formula of methoxyethane?
The condensed molecular formula of methoxyethane(also known as ethyl methyl ether):methyl group -> -CH3methoxy group -> -OCH3ethyl group -> -CH2CH3Methoxy group + ethyl group = CH3- and -O- and -CH2CH3 the condensed molecular formula is: CH3OCH2CH3
What is 2-hexenal condensed formula?
The chemical formula of 2-hexenal is C6H10O.
What is the condensed structural formula for 4-bromo-2-pentanone?
The formula is C5H9BrO.
What is the condensed structural formula of pentyl acetate?
CH3COOCH2CH2CH2CH2CH3
What is the condensed stuctural formula for ethanol?
CH3CH2OH or C2H5OH
What is the condensed structural formula for 1-pentene?
Ch3ch3ch3hch3
