0
Nope
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
3 methyl 4 chloro hexane?
CH3-CH2-CH(CH3)-CH(Cl)-CH2-CH3
What type of compound is ch3-ch2-ch2-cl?
It is an haloalkane (aka alkyl halide).
What is the Lewis structure for SbBr3?
The Lewis structure of SbCl5 has the Sb in the center with 5 Cl molecules branching off like a star. The branches of the molecules should be drawn as straight lines.
What is the molecular shape of NClO2?
An NCl3 molecule would be a trigonal pyramidal because it has one center N atom with 3 Cl surrounding it, but also a lone pair of electrons on the top which bends the molecule downward, forming a trigonal pyramidal. Its electron shape would be tetrahedral, that is when you count the lone pairs of electrons as bonds themselves.
Which is bigger 0.2 L 240 ml or 50 cl?
0.2 L = cl 1 ml = 0.1 cl 240 ml = 24.0 cl 1 L = 100 cl 0.2 L = 20 cl 50 cl is bigger than 0.2 L = 20 cl and 240 ml = 24 cl
3 methyl 4 chloro hexane?
CH3-CH2-CH(CH3)-CH(Cl)-CH2-CH3
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
How do you prepare thiokol rubber?
we will prepare thiokol rubber from 1,2 dichloroethane and sodiumpolysulphide.The reaction is:cl-CH2-CH2-cl + Na-S-S-Na + cl-CH2-CH2-cl--------------> -----(----CH2-CH2-S-S-CH2-CH2----)n--------
What type of compound is ch3-ch2-ch2-cl?
It is an haloalkane (aka alkyl halide).
What are the possible isomers of C2H5Cl?
There would be none in the case of this compound because no matter how the atoms are oriented the structure is still the same
Four isomers structure formula of C3H6Cl2?
There are four isomers of C4H9Cl or butyl chloride. These are: CH3-CH2-CH2-CH2-Cl or 1-chlorobutane, CH3-CHCl-CH2-CH3 or 2-chlorobutane, CH3-CH(CH3)-CH2-Cl or 1-chloro-2-methylpropane and CH3-C(CH3)Cl-CH3 or 2-chloro-2-methylpropane.
What is the structure for 3-chlorobutanamide?
CH3CH(Cl)-CH2-CONH2
What is the condensed stuctural formula for methane?
CH4
What is the shape of pcl5 molecule?
In the vapour and liquid it has a triangular bipyramidal sconfiguration three Cl in the same plane as P with a 120 degree Cl-P Cl bond angle. the other two Cls are at right angles. In the solid it is IONIC! PCl4+ PCl6-
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
Butane to isobutane?
This conversion is a two steps reaction, 1-photochemical halogenation of ethane, 2- wurtz reaction of ethyl chloride. CH3-CH3 + Cl2 ------- sun light -------> CH3-CH2-Cl + HCl 2CH3-CH2-Cl + 2Na ---------anhydrous ether -------> CH3-CH2-CH2-CH3 + 2NaCl
What is the stuctural diagram for chlorethane?
CH3-CH2-Cl... choloro ethane or ethyl chloride...
