0
What else can I help you with?
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
3 methyl 4 chloro hexane?
3-methyl-4-chlorohexane is a compound with six carbon atoms in a chain, a chlorine atom attached to the fourth carbon, and a methyl group attached to the third carbon. It is an alkyl halide, a type of organic compound.
What is the Structural formula of 3-chloro-2-methylpentane?
The structural formula of 3-chloro-2-methylpentane is CH3CH(Cl)CH(CH3)CH2CH3, where the chlorine atom is attached to the third carbon atom and the methyl group is attached to the second carbon atom in the pentane chain.
What type of compound is ch3-ch2-ch2-cl?
The compound CH3-CH2-CH2-Cl is an alkyl chloride. It belongs to the class of organic compounds known as alkyl halides, which are derivatives of alkanes where one or more hydrogen atoms are replaced with halogen atoms (in this case, chlorine). Alkyl chlorides are commonly used in various chemical reactions and as starting materials for organic synthesis.
What is the Lewis structure for SbBr3?
The Lewis structure of SbCl5 has the Sb in the center with 5 Cl molecules branching off like a star. The branches of the molecules should be drawn as straight lines.
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
What is the IUPAC name for ch3-ch equals ch-ch3?
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
How do you prepare thiokol rubber?
we will prepare thiokol rubber from 1,2 dichloroethane and sodiumpolysulphide.The reaction is:cl-CH2-CH2-cl + Na-S-S-Na + cl-CH2-CH2-cl--------------> -----(----CH2-CH2-S-S-CH2-CH2----)n--------
How do you write the condensed structural formula for 14-diclorocyclohexane?
The condensed structural formula for 1,4-dichlorocyclohexane is: Cl-CH2-CH2-CH2-CH2-CH2-CH2-Cl.
3 methyl 4 chloro hexane?
3-methyl-4-chlorohexane is a compound with six carbon atoms in a chain, a chlorine atom attached to the fourth carbon, and a methyl group attached to the third carbon. It is an alkyl halide, a type of organic compound.
What is the structure for 3-chlorobutanamide?
CH3CH(Cl)-CH2-CONH2
Four isomers structure formula of C3H6Cl2?
There are four isomers of C4H9Cl or butyl chloride. These are: CH3-CH2-CH2-CH2-Cl or 1-chlorobutane, CH3-CHCl-CH2-CH3 or 2-chlorobutane, CH3-CH(CH3)-CH2-Cl or 1-chloro-2-methylpropane and CH3-C(CH3)Cl-CH3 or 2-chloro-2-methylpropane.
What is the stuctural diagram for chlorethane?
CH3-CH2-Cl... choloro ethane or ethyl chloride...
What is the condensed stuctural formula for methane?
CH4
What is the Structural formula of 3-chloro-2-methylpentane?
The structural formula of 3-chloro-2-methylpentane is CH3CH(Cl)CH(CH3)CH2CH3, where the chlorine atom is attached to the third carbon atom and the methyl group is attached to the second carbon atom in the pentane chain.
What type of compound is ch3-ch2-ch2-cl?
The compound CH3-CH2-CH2-Cl is an alkyl chloride. It belongs to the class of organic compounds known as alkyl halides, which are derivatives of alkanes where one or more hydrogen atoms are replaced with halogen atoms (in this case, chlorine). Alkyl chlorides are commonly used in various chemical reactions and as starting materials for organic synthesis.
