Nope
The name of this compound is 2-chlorobutane.
3-methyl-4-chlorohexane is a compound with six carbon atoms in a chain, a chlorine atom attached to the fourth carbon, and a methyl group attached to the third carbon. It is an alkyl halide, a type of organic compound.
The structural formula of 3-chloro-2-methylpentane is CH3CH(Cl)CH(CH3)CH2CH3, where the chlorine atom is attached to the third carbon atom and the methyl group is attached to the second carbon atom in the pentane chain.
The compound CH3-CH2-CH2-Cl is an alkyl chloride. It belongs to the class of organic compounds known as alkyl halides, which are derivatives of alkanes where one or more hydrogen atoms are replaced with halogen atoms (in this case, chlorine). Alkyl chlorides are commonly used in various chemical reactions and as starting materials for organic synthesis.
Polypropylene is the correct chemical name. It is the polymer formed from the monomer propene. Propene has the structure. H2C=CHCH3 When it polymerises the double bond breaks open to form a single bond between the carbons and the 'broken' open ends combine with the next monomer to form the polymer. Structurally it is represented by ' --[-CH2 - CH(CH3)- ] -- (n) NB There are NO double bonds present. The ;'n' represents 'n' number of monomers forming the polymer. 'n' can be in the thousands or even millions. Polypropylene makes an artificial rope. NB PVC is polyvinyl chloride. In this case the 'CH3; group is replaced by a chlorine atom. --[-CH2 - CHCl- ] -- (n) from CH2=CHCl Chloroethene Polystyrene is the same again except that the 'CH3'/Cl' is replaced with a phenyl group *C6CH5) --[-CH2 - CH(C6H5)- ] -- (n) from CH2=CH(C6H5) Phenyl ethene/ .
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
The name of this compound is 2-chlorobutane.
The compound Cl-CH2-CH2-CH2-CH=CH-CH2-Br is 1-bromo-6-chloro-2-hexene.
we will prepare thiokol rubber from 1,2 dichloroethane and sodiumpolysulphide.The reaction is:cl-CH2-CH2-cl + Na-S-S-Na + cl-CH2-CH2-cl--------------> -----(----CH2-CH2-S-S-CH2-CH2----)n--------
The condensed structural formula for 1,4-dichlorocyclohexane is: Cl-CH2-CH2-CH2-CH2-CH2-CH2-Cl.
3-methyl-4-chlorohexane is a compound with six carbon atoms in a chain, a chlorine atom attached to the fourth carbon, and a methyl group attached to the third carbon. It is an alkyl halide, a type of organic compound.
CH3CH(Cl)-CH2-CONH2
There are four isomers of C4H9Cl or butyl chloride. These are: CH3-CH2-CH2-CH2-Cl or 1-chlorobutane, CH3-CHCl-CH2-CH3 or 2-chlorobutane, CH3-CH(CH3)-CH2-Cl or 1-chloro-2-methylpropane and CH3-C(CH3)Cl-CH3 or 2-chloro-2-methylpropane.
CH4
CH3-CH2-Cl... choloro ethane or ethyl chloride...
The structural formula of 3-chloro-2-methylpentane is CH3CH(Cl)CH(CH3)CH2CH3, where the chlorine atom is attached to the third carbon atom and the methyl group is attached to the second carbon atom in the pentane chain.
The compound CH3-CH2-CH2-Cl is an alkyl chloride. It belongs to the class of organic compounds known as alkyl halides, which are derivatives of alkanes where one or more hydrogen atoms are replaced with halogen atoms (in this case, chlorine). Alkyl chlorides are commonly used in various chemical reactions and as starting materials for organic synthesis.