0
yes
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Name three saturated and three unsaturated fatty acids?
Fatty Acids are the name we use to give Carboxylic Acids with long hydrocarbon chains.These hydrocarbon chains can contain one or more double bonds, which we can refer to the Fatty Acid as being unsaturated.Saturated fatty acids are simple long chains.Some Examples:SaturatedStearic Acid - CH3(CH2)16COOHLauric Acid - CH3(CH2)10COOHArachidic Acid - CH3(CH2)18COOHUnsaturatedOleic Acid - CH3(CH2)7CH=CH(CH2)7COOHErucic Acid - CH3(CH2)7CH=CH(CH2)11COOHPalmitoleic Acid - CH3(CH2)5CH=CH(CH2)7COOH
Is the most complex organic molecules are hydrocarbon chains with nothing else attached?
The simplest organic molecules are hydrocarbon chains. methane CH4, ethane H3C-CH3, Propane H3C-CH2-CH3, etc....
What is the difference between pentane and butane gas?
Butane has higher melting and boiling points.
What is the nomenclature for ch3-ch2-chch-ch2-ch2-ch3?
This could be termed as "3-heptene" or "hept-3-ene". Depending on the geometric isomers you could add the prefix cis or trans. If the 2 H atoms are on one side and the hydrocarbon chain on the other side, then it is the cis isomer. If the groups are on either sides , then it is the trans isomer.
Is n-pentane polar or nonpolar?
Heptane is non polar molecule. This molecule has only carbon and hydrogen.E.N difference between two atoms is 0.4,it is nearly equal to zero.
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
functionalized hydrocarbon
What is an unsubstituted hydrocarbon?
An unsubstituted hydrocarbon is a hydrocarbon that has no R groups. For example ethylene CH2=CH2 is unsubstituted. RCH=CH2 is monosbustituted R2C=CH2 is disubstituted R2C=CHR is trisubstituted and R2C=CR2 is tetrasubstituted. www.graciebarra.com www.gbyorbalinda.com Gracie Barra Brazilian Jiu-Jitsu
Which is best described as CH3 CH2 CH2 CH2?
This is the butyl group often called the n-butyl group. this is an alkyl group. An example is n-butyl alcohol which is CH3 CH2 CH2 CH2OH
What is the hydrocarbon for this chemical formula ch3-ch2-ch2-ch2-ch2-ch3?
6 carbon atoms in a single file chain, with no double bonds and hydrogen as the only other component: hexane
Name three saturated and three unsaturated fatty acids?
Fatty Acids are the name we use to give Carboxylic Acids with long hydrocarbon chains.These hydrocarbon chains can contain one or more double bonds, which we can refer to the Fatty Acid as being unsaturated.Saturated fatty acids are simple long chains.Some Examples:SaturatedStearic Acid - CH3(CH2)16COOHLauric Acid - CH3(CH2)10COOHArachidic Acid - CH3(CH2)18COOHUnsaturatedOleic Acid - CH3(CH2)7CH=CH(CH2)7COOHErucic Acid - CH3(CH2)7CH=CH(CH2)11COOHPalmitoleic Acid - CH3(CH2)5CH=CH(CH2)7COOH
What kind of chemical compound is called CH2?
The chemical compound that is called CH2 is a hydrocarbon. One can learn more about this chemical compound at popular on the web sources such as Chymist.
A saturated straight-chain hydrocarbon with two carbons is?
Saturated hydrocarbon means that it does not have triple or double bonds between carbon atoms. An unsaturated hydrocarbon will have triple or double, or both types of bonds between carbons. You can saturate the unsaturated hydrocarbon by adding hydrogen atoms through a given reaction. -CH=CH- + H2 -----> -CH2-CH2- Saturation does not have to be with hydrogen, it can be with chlorine, Cl2, for example.
What is molecular formula for hydrocarbon styrene?
The correct molecular formula for styrene isC6H5CH=CH2
What is h3c ch2 ch2 ch2 ch2 ch2 ch2 ch2 ch3?
The given collection of symbols is one way of writing the formula of a straight-chain hydrocarbon with 9 carbon atoms, which has the name "nonane". More conventionally: all the letters in the formula should be capitalized, since they represent the chemical elements hydrogen and carbon; the numbers should all be subscripts instead of being on the same base as the letters; and there should be a hyphen, representing a chemical bond, between each two groupings written without spaces, where there is now simply a space. The formula can also be written more compactly as H3C(CH2)7CH3.
What makes ethanol a saturated hydrocarbon?
It is a saturated hydrocarbon because it contains no double bonds in its structure. The general formula for alcohol series is CnH2n+1OH. For example, structure of ethanol is as follows:- H3C-CH2-OH
Is the most complex organic molecules are hydrocarbon chains with nothing else attached?
The simplest organic molecules are hydrocarbon chains. methane CH4, ethane H3C-CH3, Propane H3C-CH2-CH3, etc....
What is the difference between pentane and butane gas?
Butane has higher melting and boiling points.
