methyl is hydrophobic because it is non polar. the c-h bonds have little electronegativity difference I believe. water is polar, and nonpolar things don't tend to react or dissolve in polar substances.
CH3 is nonpolar, so it is hydrophobic...if CH3 is attached to another nonpolar molecule, it would be called a hydrophobic interaction within a tertiary structure of a protein.
methyl cellulose is hydrophilic
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
Fluoropropane
no it is not
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
CH3-CH2-CH3 is a gas Propane.
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
2-butene is an alkene which may undergo several addition reactions as Hydrohalogenaton, Halogenation, Hydration, Catalytic hydrogenation, Hydroxylation and so many others some are as follows.. CH3-CH=CH-CH3 + HCl -----------> CH3-CH2-CHCl-CH3 CH3-CH=CH-CH3 + Cl2 ------------> CH3-CHCl-CHCl-CH3 CH3-CH=CH-CH3 + H2O ----H+---> CH3-CH2-CHOH-CH3
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
n-butane CH3-CH2-CH2-CH3 and isobutane CH3-CH(CH3)-CH3
CH3-C(Br)(CH3)-CH3 + H2O = CH3-C(OH)(CH3)-CH3 + HBr
Butane
CH3 is.
2,2,3-tri-methyl-butane is the name of: (CH3)2-CH-C-(CH3)3 or reversely written: (CH3)3-C-CH-(CH3)2