0
I think you mean the nitrate ion. Yes, that is a polyatomic ion with a negative
charge. You write it as : NO3-
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
Is Mg(NO3)2 polar or non polar?
MgBr2 is ionic, and so would be considered polar.
Is HNO3 a polar or nonpolar covalent?
A fast way to answer it is that HNO3 is soluble in water and water is polar so HNO3 is polar Another explanation is that HNO3's H will form dipole hydrogen bonds with other molecules (IMF) thus is considered as polar
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is ionic character of NO3?
The ionic character of NO3 is -1.
Does BaCl2 and Mg NO3 2 form a precipitate?
Yes it does. BaCl2+Mg(NO3)2--->Ba(NO3)2+MgCl2
Is Mg(NO3)2 polar or non polar?
MgBr2 is ionic, and so would be considered polar.
Is HNO3 a polar or nonpolar covalent?
A fast way to answer it is that HNO3 is soluble in water and water is polar so HNO3 is polar Another explanation is that HNO3's H will form dipole hydrogen bonds with other molecules (IMF) thus is considered as polar
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
How many atoms in AL(NO3)3?
its Al + NO3 + NO3 + NO3. So one Al, three N and nine O. That makes 13 atoms.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the formula for zinc nitride?
The chemical formula for zinc nitrate is Zn(No3)2
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is ionic character of NO3?
The ionic character of NO3 is -1.
How do you bond CA 2 WITH NO3 1- in chemistry?
We need two NO3- to cancel out Na2+: Ca(NO3)2.
