0
but it isn't a carbohydrate :) It's pure fat, like all oils.
Olive Oil
Olive oil is a triacylgylceride: three fatty acids attached to a glycerol backbone. Technically it is a type of glycerolipid. Triacylglycerols(Triglycerides or Fats) are the major energy reserve for plants and animals.
Fatty Acids:
Olive Oil is a complex compound made of fatty acids, vitamins, volatile components, water soluble components and microscopic bits of olive. Primary fatty acids are Oleic and linoleic acid with a small amount of linolenic acid.
- A fatty acid has the general formula: CH3(CH2)nCOOH where n is typically an even number between 12 and 22
- If no double bonds are present the molecule is called a saturated fatty acid.
- If a chain contains double bonds, it is called an unsaturated fatty acid.
- A single double bond makes a monounsaturated fatty acid
- Oils with more that one double bond are called polyunsaturated fatty acids.
- Oleic acid is monounsaturated and makes up 55-85% of olive oil
(C17H35COOH) or CH3-(CH2)7-CH=CH-(CH2)7-COOH also known as oleate.
The IUPAC name would be cis-9-octadecenoate
- Linoleic is polyunsaturated and makes up about 9%
(C17H29COOH) or CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOH
- Linolenic, which is polyunsaturated, makes up 0-1.5%
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
Which hydrocarbon comes first when crude oil burns?
when crude oil burns,the first hydrocarbon comes out is natural gas.
Is oil a starch?
No, olive oil is not a starch. Olive oil is a fat or lipid.
How does petroleum occur in nature?
It doesn't occur in nature. It occurs as a long chain hydrocarbon, such as crude oil. Crude oil is then split up into different fractions in a fractioning column (via distillation). One of the shorter chains that has practical uses is petrol. Fractions include: Fuel oil, Diesel, lubricating oil, kerosene, jet fuels, petroleum and bottled gas.
What is the chemical name of olive oil?
Olive oil is a mixture, not a compound.
What hydrocarbons are used in diesel oil?
diesel is a hydrocarbon!
Is a short-chain hydrocarbon more viscous than a long chain hydrocarbon?
Typically the shorter the carbon chain, the LESS viscous the hydrocarbon. The longer the chain, the MORE viscous the hydrocarbon. For example consider the viscosity and molecular size in: Gasoline < Diesel < Motor Oil < Tar Viscosity increases with the molecular size and length of hydrocarbon chain.
Is propionic acid polar?
yes, it is a polar molecule because the carboxylic acid group (COOH) on the end is electron-rich. it also fairly easily loses the proton from the -OH of the carboxylic acid to make it an ion in solution (called propionate). it is also miscible with water, which is a hint that it is polar as well. polarity is a relative term, however: take the longer-chain carboxylic acids oleic acid (main component of olive oil) and stearic acid as an example. there is an unequal distribution of charge over the molecule (the hydrocarbon chain vs the COOH), yet they're pretty nonpolar and immiscible with water. the reason for this is that the hydrocarbon chain is so long it weighs the "nonpolar" side of things more heavily. the general rule for straight-chain hydrocarbon carboxylic acids is they get less polar and less strong (as an acid) as the hydrocarbon chain increases in length.
Did the Greeks invent olive oil?
No one invented olive oil. It was there inside the olives long before the Greeks appeared.
What water plus sugar?
oil typically comprises of long chained hydrocarbon molcucles (hydrocarbon are subtance made enterely from hydrogen and carbon
What is the difference between a short-chain and a long-chain hydrocarbon?
short chain hydrocarbons have a low boiling and melting point whereas high chain hydrocarbons have a higher boiling and melting point. Also, short chain hydrocarbons have a low density and higher ones have a higher density. :)
A fatty acid is a compound made of a chain of carbon atoms plus?
A fatty acid is usually found as an ester in a fat or oil. It is a hydrocarbon chain that has a terminal carboxyl (COOH) group.
What does diesel contain?
Diesel oil is the mixture of hydrocarbon with average carbon chain of 16 (usually around 8 - 28 in number of carbon).
Which oil is healthier olive oil or canola oil?
Olive oil! Are u kidding me!?
Which one is better - soybean oil or olive oil?
Olive oil is the healthier of the two. Olive oil is one of the healthiest oils, period.
What is popeye chicken lady's name?
Olive Oyl is Popeye's girlfriend .
Is light olive oil better than olive oil?
Light olive oil IS olive oil. Different varieties and types of olive oil are used for different things, so one cannot say that a certain olive oil is better than another.
How do you keep an olive log burning all night long?
If you want to keep an olive log burning try putting olive oil on the log
