0
Sodium sulfate is an ionic compound, composed of monatomic and monovalent sodium cations and polyatomic and divalent sulfate anions. The anions are internally covalently bonded, but are not compounds because they are not electrically neutral.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
Is sodium chloride a molecular element molecular compound or ionic compound?
Sodium chloride (NaCl) is an ionic compound.
Is k2so4 a molecular compound?
Potassium sulfate is an ionic compound.
Is sodium fluoride a molecular compound?
No it is not, It is an ionic compound
Is NaNO3 ionic or molecular compound?
No, like all sodium (Na) compound it is ionic.
Is sodium perchlorate ionic or molecular compound?
Sodium sulfate is an ionic compound. An ionic compound is a reaction that consists of a metal and non-metal, or essentially the attracting of a cation for an anion. i hope this helps!
Is sodium chloride a molecular element molecular compound or ionic compound?
Sodium chloride (NaCl) is an ionic compound.
Is k2so4 a molecular compound?
Potassium sulfate is an ionic compound.
Is sodium fluoride a molecular compound?
No it is not, It is an ionic compound
Is NaNO3 ionic or molecular compound?
No, like all sodium (Na) compound it is ionic.
Is sodium perchlorate ionic or molecular compound?
Sodium sulfate is an ionic compound. An ionic compound is a reaction that consists of a metal and non-metal, or essentially the attracting of a cation for an anion. i hope this helps!
What is the ionic compound name for Na2SO4?
This is sodium sulfate, or more properly sodium sulfate(VI).
Is sodium chloride an example of a molecular compound?
No, sodium chloride is an ionic compound.
Is sodium hydroxide a molecular or ionic compound?
it is a ionic compound becuase it involves a metal which is what an ionic comund is
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
Is sodium chlorate ionic or molecular?
Cesium chloride is ionic as are all cesium compounds.
Is NaI ionic or molecular compound?
NaI is ionic as are all sodium (Na) compounds
Is Na2SO4 a ionic compound?
Yes. The charge on Na (sodium) ions is 1+ and the charge on a SO4 (sulfate) ion is 2-. So to balance out the charges 2 sodium ions are needed for every sulfate ion.
