0
What else can I help you with?
Name two sources of monounsaturated fatty acids?
Olive oil, and Canola oil
What is another name for fatty acids?
Phospholipids
Drug name for Omega-3 fatty acid?
Omega-3 fatty acids are a family of n-3 fatty acids and therefore not a drug or chemical. There is no more specific a name for this group of fatty acids than omega-3. Three fatty acids in this group that are of nutritional significance in the human diet are: α-linolenic acid (ALA), eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA).
What is the scientific and common name of fat?
fatty acids or glycerol
What is the other name of vitamin f?
Essential Fatty Acids
What is a name of the molecule glycerol fatty acids?
If 1 of the glycerol's OH groups is attached to a fatty acid it is a monoglyceride. If it is 2 or 3 then it is a di or triglyceride respectively. If there are 3 fatty acids and one gycleride, then the substance is namely a lipid.
What what is trans fat?
Trans fats are saturated fats used to extend the shelf life of manys foods. Trans fats are responsible for lowering good cholesterol and raising bad cholestrol.
Is olive oil a long chain hydrocarbon?
olive oilYes it is a hydrocarbon, like all organic materials, but it isn't a carbohydrate :) It's pure fat, like all oils.Olive OilOlive oil is a triacylgylceride: three fatty acids attached to a glycerol backbone. Technically it is a type of glycerolipid. Triacylglycerols(Triglycerides or Fats) are the major energy reserve for plants and animals.Fatty Acids:Olive Oil is a complex compound made of fatty acids, vitamins, volatile components, water soluble components and microscopic bits of olive. Primary fatty acids are Oleic and linoleic acid with a small amount of linolenic acid.A fatty acid has the general formula: CH3(CH2)nCOOH where n is typically an even number between 12 and 22If no double bonds are present the molecule is called a saturated fatty acid.If a chain contains double bonds, it is called an unsaturated fatty acid.A single double bond makes a monounsaturated fatty acidOils with more that one double bond are called polyunsaturated fatty acids.Oleic acid is monounsaturated and makes up 55-85% of olive oil (C17H35COOH) or CH3-(CH2)7-CH=CH-(CH2)7-COOH also known as oleate.The IUPAC name would be cis-9-octadecenoateLinoleic is polyunsaturated and makes up about 9% (C17H29COOH) or CH3-(CH2)4-CH=CH-CH2-CH=CH-(CH2)7-COOHLinolenic, which is polyunsaturated, makes up 0-1.5%
Name three saturated and three unsaturated fatty acids?
Three examples of saturated fatty acids are palmitic acid, stearic acid, and lauric acid. These fatty acids have single bonds between carbon atoms in their hydrocarbon chains. Three examples of unsaturated fatty acids are oleic acid, linoleic acid, and arachidonic acid. These fatty acids have one or more double bonds in their hydrocarbon chains.
What is another name for omega-3?
Another name for omega-3 is alpha-linolenic acid (ALA), which is one of the essential fatty acids in this group. Omega-3 fatty acids also include eicosapentaenoic acid (EPA) and docosahexaenoic acid (DHA), which are commonly found in fish oil. These fatty acids are known for their health benefits, including supporting heart and brain health.
What us the name of the form of fatty acids in naturally occurring fats is generally called what?
Saturated
What are triglycerides and what kind of fatty acid is this?
Triglycerides are a type of fatty acid that aid in the bodily processes of the liver. They are composed of one glycerol and three fatty acids, hence the name, tri-glycerides.
